Search

SMILES identifier of lithium fluoride vs (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid

Input interpretation

lithium fluoride (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | SMILES identifier
lithium fluoride (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | SMILES identifier

Results

lithium fluoride | [Li+].[F-] (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O
lithium fluoride | [Li+].[F-] (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O

Random Queries

H2O + Cl2 + AgNO3 = HNO3 + AgCl + AgClO3
KOH + KClO3 + PH3 = H2O + KCl + K3PO4
formula of sodium permanganate vs rhenium(VI) fluoride
density of buckminsterfullerene vs lime
DOT numbers of gray selenium vs activated charcoal
HNO3 + K2CO3 = KNO3 + H2CO3
Hill formula of zinc chlorate
DOT numbers of nitrogen dioxide
alternate names of ketoxime functional group
decay constant of beta plus decay