Search

SMILES identifier of lithium fluoride vs (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid

Input interpretation

lithium fluoride (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | SMILES identifier
lithium fluoride (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | SMILES identifier

Results

lithium fluoride | [Li+].[F-] (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O
lithium fluoride | [Li+].[F-] (S)-(+)-2-fluoro-α-methyl-4-biphenylacetic acid | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O

Random Queries

molar mass of silicon(I) cation vs iodide anion
electronegativity of group 3 element
H2SO4 + NaNO2 + KIO3 = H2O + K2SO4 + I2 + NaNO3
mass magnetic susceptibilities of noble gases
CAS number of rare earth metals
take image convolution of image of howlite
H2SO4 + KMnO4 + CuI = H2O + K2SO4 + I2 + CuSO4 + MnSO4
molar mass of aluminum cation vs silver(I) cation
formula of benzyl-2,3,4,5,6-d 5alcohol
discovery year of kladnoite