Search

InChI identifier of 1,4-di(methyl-D3)benzene

Input interpretation

1, 4-di(methyl-D3)benzene | InChI identifier
1, 4-di(methyl-D3)benzene | InChI identifier

Result

InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H, 1-2H3/i1D3, 2D3
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H, 1-2H3/i1D3, 2D3

Random Queries

image of palladium
DOT numbers of antimony tribromide
copper vs arsenic vs gallium
space group name of silicon vs magnesium
freezing point of ammonium metavanadate
IUPAC name of thorium telluride
CAS number of telluric(VI) acid vs 3-bromo-5-isopropoxyphenylboronic acid
mass number of Ac-214 vs Bi-216
alternate names of thallous malonate vs fluorspar
H2SO4 + SO2 + K2Cr2O7 = H2O + K2SO4 + S + Cr2(SO4)3