Search

InChI identifier of 1,4-di(methyl-D3)benzene

Input interpretation

1, 4-di(methyl-D3)benzene | InChI identifier
1, 4-di(methyl-D3)benzene | InChI identifier

Result

InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H, 1-2H3/i1D3, 2D3
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H, 1-2H3/i1D3, 2D3

Random Queries

net ionic charge of telluride anion vs iodide anion
manganese(IV) cation
chromium(III) ions
boiling point of methyl nonadecafluorodecanoate vs 4-fluoro-3-(trifluoromethyl)phenol
critical pressure of acrolein
molar mass of silver(III) cation vs palladium(IV) cation
chemical types of potassium permanganate vs plutonium
odor of graphite
common compound names of poor metals
molar mass of phenol