Search

name of iron(II) lactate

Input interpretation

iron(II) lactate
iron(II) lactate

Chemical names and formulas

formula | FeC_6H_10O_6 Hill formula | C_6H_10FeO_6 name | iron(II) lactate IUPAC name | 2-hydroxypropanoate; iron(+2) cation alternate names | ferrous lactate | iron dilactate | iron lactate | iron lactate (2:1) mass fractions | C (carbon) 30.8% | Fe (iron) 23.9% | H (hydrogen) 4.31% | O (oxygen) 41%
formula | FeC_6H_10O_6 Hill formula | C_6H_10FeO_6 name | iron(II) lactate IUPAC name | 2-hydroxypropanoate; iron(+2) cation alternate names | ferrous lactate | iron dilactate | iron lactate | iron lactate (2:1) mass fractions | C (carbon) 30.8% | Fe (iron) 23.9% | H (hydrogen) 4.31% | O (oxygen) 41%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 233.99 g/mol
molar mass | 233.99 g/mol

Units

Chemical identifiers

CAS number | 5905-52-2 PubChem CID number | 22197 SMILES identifier | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Fe+2] InChI identifier | InChI=1/2C3H6O3.Fe/c2*1-2(4)3(5)6;/h2*2, 4H, 1H3, (H, 5, 6);/q;;+2/p-2/f2C3H5O3.Fe/q2*-1;m EU number | 227-608-0 Gmelin number | 392497 RTECS number | OD5525000
CAS number | 5905-52-2 PubChem CID number | 22197 SMILES identifier | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Fe+2] InChI identifier | InChI=1/2C3H6O3.Fe/c2*1-2(4)3(5)6;/h2*2, 4H, 1H3, (H, 5, 6);/q;;+2/p-2/f2C3H5O3.Fe/q2*-1;m EU number | 227-608-0 Gmelin number | 392497 RTECS number | OD5525000

Toxicity properties

RTECS classes | tumorigen
RTECS classes | tumorigen

Random Queries

chemical types triparanol
NFPA reactivity rating of cumene vs alpha,alpha-dimethoxytoluene
freezing point of dysprosium silicide vs platinum silicide
work function of cobalt vs arsenic
H2O + P2S5 = H2S + H3PO4
color period 3 elements
name of antimony(V) cation vs lead(II) cation
alternate names of potassium dihydrogen phosphate vs magnesium oxide
chemical types of naphthol blue black
structure diagram of zinc cation vs vanadium(III) cation