Input interpretation
benzeneboronic acid
Chemical names and formulas
formula | C_6H_5B(OH)_2 Hill formula | C_6H_7BO_2 name | benzeneboronic acid IUPAC name | phenylboronic acid alternate names | borophenylic acid | dihydroxyphenylborane | phenylboric acid | phenylboronic acid | phenyldihydroxyborane mass fractions | B (boron) 8.87% | C (carbon) 59.1% | H (hydrogen) 5.79% | O (oxygen) 26.2%
Lewis structure
Draw the Lewis structure of benzeneboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + 6 n_C, val + 7 n_H, val + 2 n_O, val = 46 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + 6 n_C, full + 7 n_H, full + 2 n_O, full = 84 Subtracting these two numbers shows that 84 - 46 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 16 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 121.93 g/mol phase | solid (at STP) melting point | 217.5 °C solubility in water | slightly soluble
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | 0.53 predicted LogS | -1.08
Basic drug properties
approval status | experimental | small molecule
Chemical identifiers
CAS number | 98-80-6 Beilstein number | 970972 PubChem CID number | 66827 PubChem SID number | 24898261 SMILES identifier | B(C1=CC=CC=C1)(O)O InChI identifier | InChI=1/C6H7BO2/c8-7(9)6-4-2-1-3-5-6/h1-5, 8-9H InChI key | HXITXNWTGFUOAU-UHFFFAOYAQ RTECS number | CY8575000 MDL number | MFCD00002103
Toxicity properties
RTECS classes | organometallic