Search

barium pentanedioate

Input interpretation

barium pentanedioate
barium pentanedioate

Basic properties

molar mass | 267.4 g/mol formula | C_5H_6BaO_4 empirical formula | C_5O_4Ba_H_6 SMILES identifier | C(CC(=O)[O-])CC(=O)[O-].[Ba+2] InChI identifier | InChI=1/C5H8O4.Ba/c6-4(7)2-1-3-5(8)9;/h1-3H2, (H, 6, 7)(H, 8, 9);/q;+2/p-2/fC5H6O4.Ba/q-2;m InChI key | VURCKCQSFXPUBR-UHFFFAOYSA-L
molar mass | 267.4 g/mol formula | C_5H_6BaO_4 empirical formula | C_5O_4Ba_H_6 SMILES identifier | C(CC(=O)[O-])CC(=O)[O-].[Ba+2] InChI identifier | InChI=1/C5H8O4.Ba/c6-4(7)2-1-3-5(8)9;/h1-3H2, (H, 6, 7)(H, 8, 9);/q;+2/p-2/fC5H6O4.Ba/q-2;m InChI key | VURCKCQSFXPUBR-UHFFFAOYSA-L

Structure diagram

 vertex count | 10 edge count | 8 Schultz index | 394 Wiener index | 108 Hosoya index | 40 Balaban index | 2.915
vertex count | 10 edge count | 8 Schultz index | 394 Wiener index | 108 Hosoya index | 40 Balaban index | 2.915

Quantitative molecular descriptors

longest chain length | 7 atoms longest straight chain length | 7 atoms longest aliphatic chain length | 5 atoms aromatic atom count | 0 atoms H-bond acceptor count | 4 atoms H-bond donor count | 0 atoms
longest chain length | 7 atoms longest straight chain length | 7 atoms longest aliphatic chain length | 5 atoms aromatic atom count | 0 atoms H-bond acceptor count | 4 atoms H-bond donor count | 0 atoms

Elemental composition

Find the elemental composition for barium pentanedioate in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_5H_6BaO_4 Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule:  | number of atoms  C (carbon) | 5  O (oxygen) | 4  Ba (barium) | 1  H (hydrogen) | 6  N_atoms = 5 + 4 + 1 + 6 = 16 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work:  | number of atoms | atom fraction  C (carbon) | 5 | 5/16  O (oxygen) | 4 | 4/16  Ba (barium) | 1 | 1/16  H (hydrogen) | 6 | 6/16 Check: 5/16 + 4/16 + 1/16 + 6/16 = 1 Compute atom percents using the atom fractions:  | number of atoms | atom percent  C (carbon) | 5 | 5/16 × 100% = 31.3%  O (oxygen) | 4 | 4/16 × 100% = 25.0%  Ba (barium) | 1 | 1/16 × 100% = 6.25%  H (hydrogen) | 6 | 6/16 × 100% = 37.5% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table:  | number of atoms | atom percent | atomic mass/u  C (carbon) | 5 | 31.3% | 12.011  O (oxygen) | 4 | 25.0% | 15.999  Ba (barium) | 1 | 6.25% | 137.327  H (hydrogen) | 6 | 37.5% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m:  | number of atoms | atom percent | atomic mass/u | mass/u  C (carbon) | 5 | 31.3% | 12.011 | 5 × 12.011 = 60.055  O (oxygen) | 4 | 25.0% | 15.999 | 4 × 15.999 = 63.996  Ba (barium) | 1 | 6.25% | 137.327 | 1 × 137.327 = 137.327  H (hydrogen) | 6 | 37.5% | 1.008 | 6 × 1.008 = 6.048  m = 60.055 u + 63.996 u + 137.327 u + 6.048 u = 267.426 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work:  | number of atoms | atom percent | mass fraction  C (carbon) | 5 | 31.3% | 60.055/267.426  O (oxygen) | 4 | 25.0% | 63.996/267.426  Ba (barium) | 1 | 6.25% | 137.327/267.426  H (hydrogen) | 6 | 37.5% | 6.048/267.426 Check: 60.055/267.426 + 63.996/267.426 + 137.327/267.426 + 6.048/267.426 = 1 Compute mass percents using the mass fractions: Answer: |   | | number of atoms | atom percent | mass percent  C (carbon) | 5 | 31.3% | 60.055/267.426 × 100% = 22.46%  O (oxygen) | 4 | 25.0% | 63.996/267.426 × 100% = 23.93%  Ba (barium) | 1 | 6.25% | 137.327/267.426 × 100% = 51.35%  H (hydrogen) | 6 | 37.5% | 6.048/267.426 × 100% = 2.262%
Find the elemental composition for barium pentanedioate in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_5H_6BaO_4 Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule: | number of atoms C (carbon) | 5 O (oxygen) | 4 Ba (barium) | 1 H (hydrogen) | 6 N_atoms = 5 + 4 + 1 + 6 = 16 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction C (carbon) | 5 | 5/16 O (oxygen) | 4 | 4/16 Ba (barium) | 1 | 1/16 H (hydrogen) | 6 | 6/16 Check: 5/16 + 4/16 + 1/16 + 6/16 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent C (carbon) | 5 | 5/16 × 100% = 31.3% O (oxygen) | 4 | 4/16 × 100% = 25.0% Ba (barium) | 1 | 1/16 × 100% = 6.25% H (hydrogen) | 6 | 6/16 × 100% = 37.5% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u C (carbon) | 5 | 31.3% | 12.011 O (oxygen) | 4 | 25.0% | 15.999 Ba (barium) | 1 | 6.25% | 137.327 H (hydrogen) | 6 | 37.5% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u C (carbon) | 5 | 31.3% | 12.011 | 5 × 12.011 = 60.055 O (oxygen) | 4 | 25.0% | 15.999 | 4 × 15.999 = 63.996 Ba (barium) | 1 | 6.25% | 137.327 | 1 × 137.327 = 137.327 H (hydrogen) | 6 | 37.5% | 1.008 | 6 × 1.008 = 6.048 m = 60.055 u + 63.996 u + 137.327 u + 6.048 u = 267.426 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction C (carbon) | 5 | 31.3% | 60.055/267.426 O (oxygen) | 4 | 25.0% | 63.996/267.426 Ba (barium) | 1 | 6.25% | 137.327/267.426 H (hydrogen) | 6 | 37.5% | 6.048/267.426 Check: 60.055/267.426 + 63.996/267.426 + 137.327/267.426 + 6.048/267.426 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent C (carbon) | 5 | 31.3% | 60.055/267.426 × 100% = 22.46% O (oxygen) | 4 | 25.0% | 63.996/267.426 × 100% = 23.93% Ba (barium) | 1 | 6.25% | 137.327/267.426 × 100% = 51.35% H (hydrogen) | 6 | 37.5% | 6.048/267.426 × 100% = 2.262%

Elemental oxidation states

The first step in finding the oxidation states (or oxidation numbers) in barium pentanedioate is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge:  In barium pentanedioate hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond:  With hydrogen out of the way, look at the remaining bonds. There are 4 carbon-oxygen bonds, and 4 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element.  First examine the carbon-oxygen bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  O | 3.44 |   | |  Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen. Decrease the oxidation number for oxygen in every highlighted bond (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly:  Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  C | 2.55 |   | |  Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states:  Now summarize the results: Answer: |   | oxidation state | element | count  -2 | C (carbon) | 3  | O (oxygen) | 4  +1 | H (hydrogen) | 6  +2 | Ba (barium) | 1  +3 | C (carbon) | 2
The first step in finding the oxidation states (or oxidation numbers) in barium pentanedioate is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In barium pentanedioate hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 4 carbon-oxygen bonds, and 4 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-oxygen bonds: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen. Decrease the oxidation number for oxygen in every highlighted bond (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -2 | C (carbon) | 3 | O (oxygen) | 4 +1 | H (hydrogen) | 6 +2 | Ba (barium) | 1 +3 | C (carbon) | 2

Orbital hybridization

hybridization | element | count  sp^2 | C (carbon) | 2  | O (oxygen) | 4  sp^3 | C (carbon) | 3
hybridization | element | count sp^2 | C (carbon) | 2 | O (oxygen) | 4 sp^3 | C (carbon) | 3

Structure diagram

Orbital hybridization Structure diagram
Orbital hybridization Structure diagram

Topological indices

vertex count | 16 edge count | 14 Schultz index | 1146 Wiener index | 320 Hosoya index | 360 Balaban index | 5.304
vertex count | 16 edge count | 14 Schultz index | 1146 Wiener index | 320 Hosoya index | 360 Balaban index | 5.304