Input interpretation
2-chloro-6-(trifluoromethyl)phenyl isocyanate
Chemical names and formulas
formula | ClC_6H_3(CF_3)NCO Hill formula | C_8H_3ClF_3NO name | 2-chloro-6-(trifluoromethyl)phenyl isocyanate IUPAC name | 1-chloro-2-isocyanato-3-(trifluoromethyl)benzene alternate names | 1-chloro-2-isocyanato-3-(trifluoromethyl)benzene mass fractions | C (carbon) 43.4% | Cl (chlorine) 16% | F (fluorine) 25.7% | H (hydrogen) 1.36% | N (nitrogen) 6.32% | O (oxygen) 7.22%
Lewis structure
Draw the Lewis structure of 2-chloro-6-(trifluoromethyl)phenyl isocyanate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 8 n_C, val + n_Cl, val + 3 n_F, val + 3 n_H, val + n_N, val + n_O, val = 74 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 8 n_C, full + n_Cl, full + 3 n_F, full + 3 n_H, full + n_N, full + n_O, full = 118 Subtracting these two numbers shows that 118 - 74 = 44 bonding electrons are needed. Each bond has two electrons, so in addition to the 17 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds, nitrogen wants 3 bonds, and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 221.56 g/mol phase | liquid (at STP) boiling point | 206 °C density | 1.489 g/cm^3
Units
Liquid properties (at STP)
density | 1.489 g/cm^3 refractive index | 1.498
Units
Chemical identifiers
CAS number | 16583-76-9 PubChem CID number | 5142393 PubChem SID number | 24873588 SMILES identifier | C1=CC(=C(C(=C1)Cl)N=C=O)C(F)(F)F InChI identifier | InChI=1/C8H3ClF3NO/c9-6-3-1-2-5(8(10, 11)12)7(6)13-4-14/h1-3H MDL number | MFCD01863686
Safety properties
flash point | 107.2 °C