Input interpretation
fmoc-(4-iodo)-phe-OH
Chemical names and formulas
![formula | C_24H_20INO_4 name | fmoc-(4-iodo)-phe-OH IUPAC name | (2S)-2-[(9H-fluoren-9-ylmethoxy-oxomethyl)amino]-3-(4-iodophenyl)propanoic acid alternate names | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-iodophenyl)propanoic acid | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-iodophenyl)propionic acid | Fmoc-4-iodo-L-phenylalanine | N-(9-fluorenylmethoxycarbonyl)-3-(4-iodophenyl)-L-alanine mass fractions | C (carbon) 56.2% | H (hydrogen) 3.93% | I (iodine) 24.7% | N (nitrogen) 2.73% | O (oxygen) 12.5%](../image_source/ed25dafa001564e745e6e596ce9282c6.png)
formula | C_24H_20INO_4 name | fmoc-(4-iodo)-phe-OH IUPAC name | (2S)-2-[(9H-fluoren-9-ylmethoxy-oxomethyl)amino]-3-(4-iodophenyl)propanoic acid alternate names | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-iodophenyl)propanoic acid | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-iodophenyl)propionic acid | Fmoc-4-iodo-L-phenylalanine | N-(9-fluorenylmethoxycarbonyl)-3-(4-iodophenyl)-L-alanine mass fractions | C (carbon) 56.2% | H (hydrogen) 3.93% | I (iodine) 24.7% | N (nitrogen) 2.73% | O (oxygen) 12.5%
Lewis structure
Draw the Lewis structure of fmoc-(4-iodo)-phe-OH. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), iodine (n_I, val = 7), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 24 n_C, val + 20 n_H, val + n_I, val + n_N, val + 4 n_O, val = 152 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 24 n_C, full + 20 n_H, full + n_I, full + n_N, full + 4 n_O, full = 280 Subtracting these two numbers shows that 280 - 152 = 128 bonding electrons are needed. Each bond has two electrons, so in addition to the 53 bonds already present in the diagram add 11 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 11 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 513.33 g/mol phase | solid (at STP) melting point | 215 °C
Units
Chemical identifiers
CAS number | 82565-68-2 PubChem CID number | 2761479 PubChem SID number | 24870532 SMILES identifier | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)I)C(=O)O InChI identifier | InChI=1/C24H20INO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12, 21-22H, 13-14H2, (H, 26, 29)(H, 27, 28)/t22-/m0/s1/f/h26-27H MDL number | MFCD00672340