Search

isomeric SMILES identifier of norethindrone

Input interpretation

norethindrone | isomeric SMILES identifier
norethindrone | isomeric SMILES identifier

Result

C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1CC[C@@]2(O)C#C
C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1CC[C@@]2(O)C#C

Random Queries

name of dimercury(I) cation
discovery year of group 17 elements
molar mass of thullium(III) cation
boiling point of 1,1,2,2-tetrafluoroethane
density of silicon monoxide
chemical types of 4-(trifluoromethylthio)benzyl bromide vs methyl propyl disulfide
melting point of cyclopentane vs 2,2,3-trimethylpentane
name of gallium(III) cation vs iodide anion
molar mass of scandium(III) cation vs gold(III) cation
molar mass of sulfur hexafluoride vs 8-quinolinyl trifluoromethanesulfonate