Search

InChI identifier of boric acid

Input interpretation

boric acid | InChI identifier
boric acid | InChI identifier

Result

InChI=1/BH3O3/c2-1(3)4/h2-4H
InChI=1/BH3O3/c2-1(3)4/h2-4H

Random Queries

freezing point of mixtures
alternate names of manganese(IV) cation vs chromium(III) cation
IUPAC name of vancomycin hydrochloride
name of deuteroxide anion vs antimonate anion
chemical types of americium vs thulium(III) chloride hexahydrate
longest straight chain length of sodium amide
IUPAC name of magnesium oxide vs nickel
chemical types of dichlorine heptoxide
KOH + P2O5 = H2O + K3PO4
name of hexaiodoplatinate(IV) anion