Input interpretation
dichromic acid
Chemical names and formulas
formula | H_2Cr_2O_7 Hill formula | Cr_2H_2O_7 name | dichromic acid IUPAC name | hydroxy-(hydroxy-dioxo-chromio)oxy-dioxo-chromium alternate names | bichromate of potash | chromic acid, solution | dichromic(VI) acid mass fractions | Cr (chromium) 47.7% | H (hydrogen) 0.925% | O (oxygen) 51.4%
Structure diagram
Structure diagram
| bond counts | bond lengths | bond energies | 2 bonds | 1 Å | 459 kJ/mol | 4 bonds | | | 4 bonds | |
vertex count | 9 edge count | 10 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
3D structure
3D structure
Basic properties
molar mass | 218 g/mol density | 1.66 g/cm^3
Units
Chemical identifiers
(=O)O[Cr](=O)(=O)O InChI identifier | InChI=1/2Cr.2H2O.5O/h;;2*1H2;;;;;/q2*+1;;;;;;;/p-2/f2Cr.2HO.5O/h;;2*1h;;;;;/q2m;2*-1;;;;;/rCr2H2O7/c3-1(4, 5)9-2(6, 7)8/h3, 6H EU number | 236-881-5 Gmelin number | 101517 RTECS number | GB2650000 NSC number | 77372](../image_source/107ed63d3581bb8ce4e9354325020114.png)
CAS number | 13530-68-2 PubChem CID number | 26090 SMILES identifier | O[Cr](=O)(=O)O[Cr](=O)(=O)O InChI identifier | InChI=1/2Cr.2H2O.5O/h;;2*1H2;;;;;/q2*+1;;;;;;;/p-2/f2Cr.2HO.5O/h;;2*1h;;;;;/q2m;2*-1;;;;;/rCr2H2O7/c3-1(4, 5)9-2(6, 7)8/h3, 6H EU number | 236-881-5 Gmelin number | 101517 RTECS number | GB2650000 NSC number | 77372