Search

InChI identifier of oxalyl dihydrazide

Input interpretation

oxalyl dihydrazide | InChI identifier
oxalyl dihydrazide | InChI identifier

Result

InChI=1/C2H6N4O2/c3-5-1(7)2(8)6-4/h3-4H2, (H, 5, 7)(H, 6, 8)/f/h5-6H
InChI=1/C2H6N4O2/c3-5-1(7)2(8)6-4/h3-4H2, (H, 5, 7)(H, 6, 8)/f/h5-6H

Random Queries

boiling point of fluorotrimethylsilane
d-spacing of cristobalite
IUPAC name of 4-phenylbenzyl chloride
melting point of gray selenium vs black phosphorus
common sources of ion of mercury(II) cation vs iron(II) cation
formula of palladium(IV) cation vs cobalt(III) cation
atomic radius of phosphorus vs sulfur
Ca(OH)2 + NH4NO3 = H2O + NH3 + Ca(NO3)2
formula of neostigmine ion
formula of magnesium hydroxide vs iron nickel oxide