Search

properties of pearl ash

Input interpretation

pearl ash
pearl ash

Chemical names and formulas

formula | K_2CO_3 Hill formula | CK_2O_3 name | pearl ash IUPAC name | dipotassium carbonate alternate names | dipotassium carbonate | potash | potassium carbonate | salt of tartar mass fractions | C (carbon) 8.69% | K (potassium) 56.6% | O (oxygen) 34.7%
formula | K_2CO_3 Hill formula | CK_2O_3 name | pearl ash IUPAC name | dipotassium carbonate alternate names | dipotassium carbonate | potash | potassium carbonate | salt of tartar mass fractions | C (carbon) 8.69% | K (potassium) 56.6% | O (oxygen) 34.7%

Structure diagram

Structure diagram
Structure diagram
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 138.2 g/mol phase | solid (at STP) melting point | 891 °C density | 2.43 g/cm^3 solubility in water | soluble
molar mass | 138.2 g/mol phase | solid (at STP) melting point | 891 °C density | 2.43 g/cm^3 solubility in water | soluble

Units

Solid properties (at STP)

density | 2.43 g/cm^3
density | 2.43 g/cm^3

Units

Thermodynamic properties

specific heat capacity c_p | solid | 8.2776 J/(g K) molar heat capacity c_p | solid | 1144 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.695 kJ/g molar free energy of formation Δ_fG° | solid | -1064 kJ/mol specific heat of formation Δ_fH° | solid | -8.328 kJ/g molar heat of formation Δ_fH° | solid | -1151 kJ/mol molar heat of fusion | 27.6 kJ/mol | specific heat of fusion | 0.2 kJ/g | (at STP)
specific heat capacity c_p | solid | 8.2776 J/(g K) molar heat capacity c_p | solid | 1144 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.695 kJ/g molar free energy of formation Δ_fG° | solid | -1064 kJ/mol specific heat of formation Δ_fH° | solid | -8.328 kJ/g molar heat of formation Δ_fH° | solid | -1151 kJ/mol molar heat of fusion | 27.6 kJ/mol | specific heat of fusion | 0.2 kJ/g | (at STP)

Chemical identifiers

CAS number | 584-08-7 Beilstein number | 4267587 PubChem CID number | 516886 PubChem SID number | 24862856 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m RTECS number | TS7750000 MDL number | MFCD00011382
CAS number | 584-08-7 Beilstein number | 4267587 PubChem CID number | 516886 PubChem SID number | 24862856 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m RTECS number | TS7750000 MDL number | MFCD00011382

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

lethal dosage | 1870 mg/kg (oral dose for rats)
lethal dosage | 1870 mg/kg (oral dose for rats)
probable lethal dose for man | 600 mL (milliliters) RTECS classes | mutagen
probable lethal dose for man | 600 mL (milliliters) RTECS classes | mutagen

Ion equivalents

K^+ (potassium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1
K^+ (potassium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1

Random Queries

density of barium chromate(V)
H2O + KBr = H2 + KBrO3
phase of molybdenum disilicide
structure diagram of antimonite anion vs borate anion
bonding characteristics of thorium
name of manganese(IV) cation vs palladium(II) cation
magnetism of kladnoite
discovery year of moolooite
magnesium chloride vs sodium amide
density of antimony