Search

properties of pearl ash

Input interpretation

pearl ash
pearl ash

Chemical names and formulas

formula | K_2CO_3 Hill formula | CK_2O_3 name | pearl ash IUPAC name | dipotassium carbonate alternate names | dipotassium carbonate | potash | potassium carbonate | salt of tartar mass fractions | C (carbon) 8.69% | K (potassium) 56.6% | O (oxygen) 34.7%
formula | K_2CO_3 Hill formula | CK_2O_3 name | pearl ash IUPAC name | dipotassium carbonate alternate names | dipotassium carbonate | potash | potassium carbonate | salt of tartar mass fractions | C (carbon) 8.69% | K (potassium) 56.6% | O (oxygen) 34.7%

Structure diagram

Structure diagram
Structure diagram
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 138.2 g/mol phase | solid (at STP) melting point | 891 °C density | 2.43 g/cm^3 solubility in water | soluble
molar mass | 138.2 g/mol phase | solid (at STP) melting point | 891 °C density | 2.43 g/cm^3 solubility in water | soluble

Units

Solid properties (at STP)

density | 2.43 g/cm^3
density | 2.43 g/cm^3

Units

Thermodynamic properties

specific heat capacity c_p | solid | 8.2776 J/(g K) molar heat capacity c_p | solid | 1144 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.695 kJ/g molar free energy of formation Δ_fG° | solid | -1064 kJ/mol specific heat of formation Δ_fH° | solid | -8.328 kJ/g molar heat of formation Δ_fH° | solid | -1151 kJ/mol molar heat of fusion | 27.6 kJ/mol | specific heat of fusion | 0.2 kJ/g | (at STP)
specific heat capacity c_p | solid | 8.2776 J/(g K) molar heat capacity c_p | solid | 1144 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.695 kJ/g molar free energy of formation Δ_fG° | solid | -1064 kJ/mol specific heat of formation Δ_fH° | solid | -8.328 kJ/g molar heat of formation Δ_fH° | solid | -1151 kJ/mol molar heat of fusion | 27.6 kJ/mol | specific heat of fusion | 0.2 kJ/g | (at STP)

Chemical identifiers

CAS number | 584-08-7 Beilstein number | 4267587 PubChem CID number | 516886 PubChem SID number | 24862856 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m RTECS number | TS7750000 MDL number | MFCD00011382
CAS number | 584-08-7 Beilstein number | 4267587 PubChem CID number | 516886 PubChem SID number | 24862856 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m RTECS number | TS7750000 MDL number | MFCD00011382

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

lethal dosage | 1870 mg/kg (oral dose for rats)
lethal dosage | 1870 mg/kg (oral dose for rats)
probable lethal dose for man | 600 mL (milliliters) RTECS classes | mutagen
probable lethal dose for man | 600 mL (milliliters) RTECS classes | mutagen

Ion equivalents

K^+ (potassium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1
K^+ (potassium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1

Random Queries

SMILES identifier of greenhouse gases
color of lead vs praseodymium
vertex types of beryllium
melting point of scandium tribromide vs (1,3-dioxolan-2-ylmethyl)triphenylphosphonium bromide
H2SO4 + KMnO4 + MgI2 = H2O + K2SO4 + I2 + MnSO4 + MgSO4
InChI identifier of carbocreatine vs (R)-(-)-2-pentanol
color of magnesiohornblende vs barylite
net ionic charge of hexaaquamanganese II
chemical types of uranium(III) fluoride vs 2,2,3,3,4,4,5,5-octafluoro-1,6-hexanediol
molar mass of tantalum diboride