Search

SMILES identifier of nickel carbonate vs bismuth titanate

Input interpretation

nickel carbonate bismuth titanate | SMILES identifier
nickel carbonate bismuth titanate | SMILES identifier

Results

nickel carbonate | C(=O)([O-])[O-].[Ni+2] bismuth titanate | O=[Ti]=O.O=[Ti]=O.O=[Bi]O[Bi]=O
nickel carbonate | C(=O)([O-])[O-].[Ni+2] bismuth titanate | O=[Ti]=O.O=[Ti]=O.O=[Bi]O[Bi]=O

Random Queries

flash point of 2-fluorophenyl isocyanate
HCl + PbO2 = H2O + Cl2 + PbCl2
structure diagram of palladium(II) cation vs nickel(II) cation
net ionic charge of magnesium cation
atomic mass of Ga-70 vs Sb-106
DOT numbers of 1-(trimethylsilyl)piperidine vs 1,3-dimethyl-2-imidazolidinone
silver fluoride
CAS number of hydrogen bromide vs hydrogen fluoride
atomic volume of carbon vs selenium
boiling point of 1-chloro-1-fluoroethylene