Search

InChI identifier of heptadecanoyl chloride

Input interpretation

heptadecanoyl chloride | InChI identifier
heptadecanoyl chloride | InChI identifier

Result

InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3
InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3

Random Queries

HCl + Cu2O = H2O + CuCl
carbon, hydrogen, iodine
Hill formula string lithium deuteride
Gmelin number of nickel(II) nitrate
H2O + SO2 + HClO3 = H2SO4 + Cl2O
vertex count of 2,4-dicyclohexyl-2-methylpentane
polygodial
color of oxygen vs hydrogen
atomic diameter of group 1 elements
phases of tin allotropes