Input interpretation
methyl phenyl sulfoxide
Chemical names and formulas
formula | CH_3SOC_6H_5 Hill formula | C_7H_8OS name | methyl phenyl sulfoxide IUPAC name | methylsulfinylbenzene alternate names | methylsulfinylbenzene mass fractions | C (carbon) 60% | H (hydrogen) 5.75% | O (oxygen) 11.4% | S (sulfur) 22.9%
Lewis structure
Draw the Lewis structure of methyl phenyl sulfoxide. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), oxygen (n_O, val = 6), and sulfur (n_S, val = 6) atoms: 7 n_C, val + 8 n_H, val + n_O, val + n_S, val = 48 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), oxygen (n_O, full = 8), and sulfur (n_S, full = 8): 7 n_C, full + 8 n_H, full + n_O, full + n_S, full = 88 Subtracting these two numbers shows that 88 - 48 = 40 bonding electrons are needed. Each bond has two electrons, so in addition to the 17 bonds already present in the diagram we expect to add 3 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Add 3 bonds by pairing electrons between adjacent highlighted atoms. Additionally, atoms with large electronegativities can minimize their formal charge by forcing atoms with smaller electronegativities on period 3 or higher to expand their valence shells. The electronegativities of the atoms are 2.20 (hydrogen), 2.55 (carbon), 2.58 (sulfur), and 3.44 (oxygen). Because the electronegativity of sulfur is smaller than the electronegativity of oxygen, expand the valence shell of sulfur to 4 bonds. Therefore we add a total of 4 bonds to the diagram. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 140.2 g/mol phase | solid (at STP) melting point | 27.5 °C boiling point | 139.5 °C (measured at 1866 Pa)
Units
Solid properties (at STP)
refractive index | 1.578
Chemical identifiers
CAS number | 1193-82-4 Beilstein number | 1904976 PubChem CID number | 14516 PubChem SID number | 24855831 SMILES identifier | CS(=O)C1=CC=CC=C1 InChI identifier | InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H, 1H3 MDL number | MFCD00002088
Safety properties
flash point | 86.11 °C