Search

name of silicon(I) cation

Input interpretation

silicon(I) cation | name
silicon(I) cation | name

Result

silicon(I) cation
silicon(I) cation

Random Queries

molar mass of platinum(VI) cation vs mercury(II) cation
electron shell configuration of lawrencium
CAS number of carbonyl bromide
formula of ytterbium(III) cation
KOH + P2O5 = H2O + K2HPO4
HF + UO2 = H2O + UF4
boiling point of sodium fluoride
density of potassium dihydrogen phosphate
density ethylene dibromide
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3