Search

name of molybdenum trioxide

Input interpretation

molybdenum trioxide
molybdenum trioxide

Chemical names and formulas

formula | MoO_3 name | molybdenum trioxide IUPAC name | trioxomolybdenum alternate names | molybdena | molybdenum oxide | molybdenum(VI) oxide | molybdic oxide | triketomolybdenum | trioxomolybdenum mass fractions | Mo (molybdenum) 66.7% | O (oxygen) 33.3%
formula | MoO_3 name | molybdenum trioxide IUPAC name | trioxomolybdenum alternate names | molybdena | molybdenum oxide | molybdenum(VI) oxide | molybdic oxide | triketomolybdenum | trioxomolybdenum mass fractions | Mo (molybdenum) 66.7% | O (oxygen) 33.3%

Structure diagram

Structure diagram
Structure diagram
 | bond counts  | 3 bonds
| bond counts | 3 bonds
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

3D structure

3D structure
3D structure

Basic properties

molar mass | 143.9 g/mol phase | solid (at STP) melting point | 795 °C boiling point | 1155 °C density | 4.69 g/cm^3
molar mass | 143.9 g/mol phase | solid (at STP) melting point | 795 °C boiling point | 1155 °C density | 4.69 g/cm^3

Units

Solid properties (at STP)

density | 4.69 g/cm^3 vapor pressure | 1003 mmHg (at 955 °C)
density | 4.69 g/cm^3 vapor pressure | 1003 mmHg (at 955 °C)

Units

Thermodynamic properties

specific heat capacity c_p | solid | 0.521 J/(g K) molar heat capacity c_p | solid | 75 J/(mol K) specific free energy of formation Δ_fG° | solid | -4.641 kJ/g molar free energy of formation Δ_fG° | solid | -668 kJ/mol specific heat of formation Δ_fH° | solid | -5.176 kJ/g molar heat of formation Δ_fH° | solid | -745.1 kJ/mol molar heat of fusion | 48.7 kJ/mol |  specific heat of fusion | 0.338 kJ/g |  (at STP)
specific heat capacity c_p | solid | 0.521 J/(g K) molar heat capacity c_p | solid | 75 J/(mol K) specific free energy of formation Δ_fG° | solid | -4.641 kJ/g molar free energy of formation Δ_fG° | solid | -668 kJ/mol specific heat of formation Δ_fH° | solid | -5.176 kJ/g molar heat of formation Δ_fH° | solid | -745.1 kJ/mol molar heat of fusion | 48.7 kJ/mol | specific heat of fusion | 0.338 kJ/g | (at STP)

Chemical identifiers

CAS number | 1313-27-5 PubChem CID number | 14802 PubChem SID number | 24852067 SMILES identifier | O=[Mo](=O)=O InChI identifier | InChI=1/Mo.3O/rMoO3/c2-1(3)4 RTECS number | QA4725000 MDL number | MFCD00003469
CAS number | 1313-27-5 PubChem CID number | 14802 PubChem SID number | 24852067 SMILES identifier | O=[Mo](=O)=O InChI identifier | InChI=1/Mo.3O/rMoO3/c2-1(3)4 RTECS number | QA4725000 MDL number | MFCD00003469

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

odor | odorless
odor | odorless
RTECS classes | tumorigen | mutagen | human data
RTECS classes | tumorigen | mutagen | human data