Search

InChI identifier of 3-chloro-4-(3'-chlorobenzyloxy)phenylboronic acid

Input interpretation

3-chloro-4-(3'-chlorobenzyloxy)phenylboronic acid | InChI identifier
3-chloro-4-(3'-chlorobenzyloxy)phenylboronic acid | InChI identifier

Result

InChI=1/C13H11BCl2O3/c15-11-3-1-2-9(6-11)8-19-13-5-4-10(14(17)18)7-12(13)16/h1-7, 17-18H, 8H2
InChI=1/C13H11BCl2O3/c15-11-3-1-2-9(6-11)8-19-13-5-4-10(14(17)18)7-12(13)16/h1-7, 17-18H, 8H2

Random Queries

alternate names of osmium vs thallium(I) fluoride
freezing point of ceric oxide
alternate names of rhodium vs osmium
Hill formula of methyl chloride
molar mass of erythromycin stearate vs ricinoleic acid
alternate names of nitrosyl chloride vs lead(II) phthalocyanine
common compound names of chlorine
common compound names of beryllium
formula of rubidium hydroxide vs lithium diethylamide
O2 + C2H2O4 = H2O + CO2