Search

name of arsenic(V) oxide hydrate

Input interpretation

arsenic(V) oxide hydrate
arsenic(V) oxide hydrate

Chemical names and formulas

formula | As_2O_5·xH_2O Hill formula | As_2H_2O_6 name | arsenic(V) oxide hydrate mass fractions | As (arsenic) 60.5% | H (hydrogen) 0.813% | O (oxygen) 38.7%
formula | As_2O_5·xH_2O Hill formula | As_2H_2O_6 name | arsenic(V) oxide hydrate mass fractions | As (arsenic) 60.5% | H (hydrogen) 0.813% | O (oxygen) 38.7%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 247.85 g/mol density | 4.32 g/cm^3
molar mass | 247.85 g/mol density | 4.32 g/cm^3

Units

Chemical identifiers

CAS number | 12044-50-7 PubChem CID number | 16211720 PubChem SID number | 24855456 SMILES identifier | O.O=[As](=O)O[As](=O)=O InChI identifier | InChI=1/As2O5.H2O/c3-1(4)7-2(5)6;/h;1H2 MDL number | MFCD00149146
CAS number | 12044-50-7 PubChem CID number | 16211720 PubChem SID number | 24855456 SMILES identifier | O.O=[As](=O)O[As](=O)=O InChI identifier | InChI=1/As2O5.H2O/c3-1(4)7-2(5)6;/h;1H2 MDL number | MFCD00149146

Random Queries

InChI identifier of magnesium oxide vs magnesium pyrophosphate
mass number of Ac-209 vs Re-180
term symbol of radioactive elements
molar mass of manganese(V) cation vs hypomanganate anion
alternate names of sodium vs rubidium
density of indium vs zirconium
name of hexaamminemanganese(II) cation
CAS number of copper(II) silicate dihydrate
density of thallium(I) oxalate
boiling point of helium vs oxygen