Input interpretation
aminoethylpyridinium chloride
Basic properties
molar mass | 158.6 g/mol formula | C_7H_11ClN_2 empirical formula | Cl_N_2C_7H_11 SMILES identifier | C1=CC=[N+](C=C1)CCN.[Cl-] InChI identifier | InChI=1/C7H11N2.ClH/c8-4-7-9-5-2-1-3-6-9;/h1-3, 5-6H, 4, 7-8H2;1H/q+1;/p-1/fC7H11N2.Cl/h;1h/qm;-1 InChI key | GFXNTAWPQNCFEV-UHFFFAOYSA-M
Structure diagram
vertex count | 10 edge count | 11 Schultz index | 399 Wiener index | 94 Hosoya index | 70 Balaban index | 2.078
Estimated thermodynamic properties
melting point | 41.82 °C boiling point | 227.4 °C critical temperature | 722.3 K critical pressure | 3.844 MPa critical volume | 439.5 cm^3/mol molar heat of vaporization | 49.7 kJ/mol molar heat of fusion | 20.53 kJ/mol molar enthalpy | 67.2 kJ/mol molar free energy | 240.1 kJ/mol (computed using the Joback method)
Units
Quantitative molecular descriptors
longest chain length | 7 atoms longest straight chain length | 3 atoms longest aliphatic chain length | 2 atoms aromatic atom count | 6 atoms H-bond acceptor count | 1 atom H-bond donor count | 1 atom
Elemental composition
Find the elemental composition for aminoethylpyridinium chloride in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_7H_11ClN_2 Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule: | number of atoms Cl (chlorine) | 1 N (nitrogen) | 2 C (carbon) | 7 H (hydrogen) | 11 N_atoms = 1 + 2 + 7 + 11 = 21 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Cl (chlorine) | 1 | 1/21 N (nitrogen) | 2 | 2/21 C (carbon) | 7 | 7/21 H (hydrogen) | 11 | 11/21 Check: 1/21 + 2/21 + 7/21 + 11/21 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Cl (chlorine) | 1 | 1/21 × 100% = 4.76% N (nitrogen) | 2 | 2/21 × 100% = 9.52% C (carbon) | 7 | 7/21 × 100% = 33.3% H (hydrogen) | 11 | 11/21 × 100% = 52.4% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Cl (chlorine) | 1 | 4.76% | 35.45 N (nitrogen) | 2 | 9.52% | 14.007 C (carbon) | 7 | 33.3% | 12.011 H (hydrogen) | 11 | 52.4% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Cl (chlorine) | 1 | 4.76% | 35.45 | 1 × 35.45 = 35.45 N (nitrogen) | 2 | 9.52% | 14.007 | 2 × 14.007 = 28.014 C (carbon) | 7 | 33.3% | 12.011 | 7 × 12.011 = 84.077 H (hydrogen) | 11 | 52.4% | 1.008 | 11 × 1.008 = 11.088 m = 35.45 u + 28.014 u + 84.077 u + 11.088 u = 158.629 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Cl (chlorine) | 1 | 4.76% | 35.45/158.629 N (nitrogen) | 2 | 9.52% | 28.014/158.629 C (carbon) | 7 | 33.3% | 84.077/158.629 H (hydrogen) | 11 | 52.4% | 11.088/158.629 Check: 35.45/158.629 + 28.014/158.629 + 84.077/158.629 + 11.088/158.629 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Cl (chlorine) | 1 | 4.76% | 35.45/158.629 × 100% = 22.35% N (nitrogen) | 2 | 9.52% | 28.014/158.629 × 100% = 17.66% C (carbon) | 7 | 33.3% | 84.077/158.629 × 100% = 53.00% H (hydrogen) | 11 | 52.4% | 11.088/158.629 × 100% = 6.990%
Elemental oxidation states
The first step in finding the oxidation states (or oxidation numbers) in aminoethylpyridinium chloride is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In aminoethylpyridinium chloride hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 4 carbon-nitrogen bonds, and 5 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-nitrogen bonds: element | electronegativity (Pauling scale) | C | 2.55 | N | 3.04 | | | Since nitrogen is more electronegative than carbon, the electrons in these bonds will go to nitrogen. Decrease the oxidation number for nitrogen in every highlighted bond (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | N (nitrogen) | 2 -1 | C (carbon) | 5 | Cl (chlorine) | 1 0 | C (carbon) | 1 +1 | C (carbon) | 1 | H (hydrogen) | 11
Orbital hybridization
hybridization | element | count sp^2 | C (carbon) | 5 | N (nitrogen) | 1 sp^3 | C (carbon) | 2 | N (nitrogen) | 1
Structure diagram
Orbital hybridization Structure diagram
Topological indices
vertex count | 21 edge count | 20 Schultz index | 2664 Wiener index | 695 Hosoya index | 4924 Balaban index | 3.215