Search

isopropamide iodide

Input interpretation

isopropamide iodide
isopropamide iodide

Chemical names and formulas

formula | C_23H_33IN_2O name | isopropamide iodide IUPAC name | (3-carbamoyl-3, 3-diphenyl-propyl)-methyl-dipropan-2-yl-azanium iodide alternate names | dipramide mass fractions | C (carbon) 57.5% | H (hydrogen) 6.92% | I (iodine) 26.4% | N (nitrogen) 5.83% | O (oxygen) 3.33%
formula | C_23H_33IN_2O name | isopropamide iodide IUPAC name | (3-carbamoyl-3, 3-diphenyl-propyl)-methyl-dipropan-2-yl-azanium iodide alternate names | dipramide mass fractions | C (carbon) 57.5% | H (hydrogen) 6.92% | I (iodine) 26.4% | N (nitrogen) 5.83% | O (oxygen) 3.33%

Structure diagram

Structure diagram
Structure diagram
vertex count | 27 edge count | 29 Schultz index | 6026 Wiener index | 1493 Hosoya index | 155196 Balaban index | 2.31
vertex count | 27 edge count | 29 Schultz index | 6026 Wiener index | 1493 Hosoya index | 155196 Balaban index | 2.31

Basic properties

molar mass | 480.43 g/mol phase | solid (at STP) melting point | 199 °C
molar mass | 480.43 g/mol phase | solid (at STP) melting point | 199 °C

Units

Hydrophobicity and permeability properties

predicted LogP hydrophobicity | 2.27 predicted LogS | -6.96
predicted LogP hydrophobicity | 2.27 predicted LogS | -6.96

Basic drug properties

approval status | approved | small molecule drug categories | gastrointestinal agent
approval status | approved | small molecule drug categories | gastrointestinal agent
brand names | darbid | dipramid | dipramide | isamid | marygin-M | piaccamide | priamide | priazimide | sanulcin | tyrimide
brand names | darbid | dipramid | dipramide | isamid | marygin-M | piaccamide | priamide | priazimide | sanulcin | tyrimide

Chemical identifiers

CAS number | 71-81-8 Beilstein number | 3816406 PubChem CID number | 6284 PubChem SID number | 9267 SMILES identifier | CC(C)[N+](C)(CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N)C(C)C.[I-] InChI identifier | InChI=1/C23H32N2O.HI/c1-18(2)25(5, 19(3)4)17-16-23(22(24)26, 20-12-8-6-9-13-20)21-14-10-7-11-15-21;/h6-15, 18-19H, 16-17H2, 1-5H3, (H-, 24, 26);1H/fC23H33N2O.I/h24H2;1h/q+1;-1 InChI key | JTPUMZTWMWIVPA-RUUSUVOICS EU number | 200-766-8 RTECS number | BP0693200 NSC number | 15521
CAS number | 71-81-8 Beilstein number | 3816406 PubChem CID number | 6284 PubChem SID number | 9267 SMILES identifier | CC(C)[N+](C)(CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N)C(C)C.[I-] InChI identifier | InChI=1/C23H32N2O.HI/c1-18(2)25(5, 19(3)4)17-16-23(22(24)26, 20-12-8-6-9-13-20)21-14-10-7-11-15-21;/h6-15, 18-19H, 16-17H2, 1-5H3, (H-, 24, 26);1H/fC23H33N2O.I/h24H2;1h/q+1;-1 InChI key | JTPUMZTWMWIVPA-RUUSUVOICS EU number | 200-766-8 RTECS number | BP0693200 NSC number | 15521

Toxicity properties

RTECS classes | drug
RTECS classes | drug