Search

InChI identifier of sodium chlorate

Input interpretation

sodium chlorate | InChI identifier
sodium chlorate | InChI identifier

Result

InChI=1/ClHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Na/q-1;m
InChI=1/ClHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Na/q-1;m

Random Queries

(freezing point of tetraethylene glycol)/(melting point of tetraethylene glycol)
molar mass of thallium(II) cation vs fluoride anion
formula of mercury(II) cation vs iron(II) cation
molar volume of semiconductors
structure diagram of ruthenium(I) cation vs titanium(IV) cation
Cl2 + MgBr2 = Br2 + MgCl2
longest straight chain sodium fluoride
refractive indices of niedermayrite
HNO3 + AlCl3 = HCl + Al(NO3)3
relative molecular mass of sucrose