Search

InChI identifier of pearl ash

Input interpretation

pearl ash | InChI identifier
pearl ash | InChI identifier

Result

InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m
InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m

Random Queries

common compound names of molybdenum
van der Waals radius of transition metals
MDL number of 2-pentyl isocyanide vs D-fenchol
net ionic charge of gallium(III) cation vs tetrachlorogallate(III) anion
fracture of shafranovskite
melting point of osmium pentacarbonyl
alternate names of sodium hydroxide
freezing point of rubidium
IUPAC name of lithium deuteride vs sodium bromate
Al + AgNO3 = Ag + Al(NO3)3