Input interpretation
perfluorotridecanoic acid
Chemical names and formulas
formula | F_3C(CF_2)_11CO_2H Hill formula | C_13HF_25O_2 name | perfluorotridecanoic acid IUPAC name | 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 13-pentacosafluorotridecanoic acid alternate names | 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 13-pentacosafluorotridecanoic acid mass fractions | C (carbon) 23.5% | F (fluorine) 71.5% | H (hydrogen) 0.152% | O (oxygen) 4.82%
Lewis structure
Draw the Lewis structure of perfluorotridecanoic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 13 n_C, val + 25 n_F, val + n_H, val + 2 n_O, val = 240 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 13 n_C, full + 25 n_F, full + n_H, full + 2 n_O, full = 322 Subtracting these two numbers shows that 322 - 240 = 82 bonding electrons are needed. Each bond has two electrons, so in addition to the 40 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 664.11 g/mol phase | solid (at STP) melting point | 117.5 °C
Units
Chemical identifiers
CAS number | 72629-94-8 PubChem CID number | 3018355 PubChem SID number | 24884076 SMILES identifier | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O InChI identifier | InChI=1/C13HF25O2/c14-2(15, 1(39)40)3(16, 17)4(18, 19)5(20, 21)6(22, 23)7(24, 25)8(26, 27)9(28, 29)10(30, 31)11(32, 33)12(34, 35)13(36, 37)38/h(H, 39, 40)/f/h39H MDL number | MFCD07369784