Search

D-allose

Input interpretation

D-allose
D-allose

Chemical names and formulas

formula | C_6H_12O_6 name | D-allose IUPAC name | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)tetrahydropyran-2, 3, 4, 5-tetrol alternate names | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)tetrahydropyran-2, 3, 4, 5-tetrol | (2R, 3R, 4R, 5S, 6R)-6-methyloltetrahydropyran-2, 3, 4, 5-tetrol | All | allose | β-D-allopyranose | β-D-allose mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%
formula | C_6H_12O_6 name | D-allose IUPAC name | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)tetrahydropyran-2, 3, 4, 5-tetrol alternate names | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol | (2R, 3R, 4R, 5S, 6R)-6-(hydroxymethyl)tetrahydropyran-2, 3, 4, 5-tetrol | (2R, 3R, 4R, 5S, 6R)-6-methyloltetrahydropyran-2, 3, 4, 5-tetrol | All | allose | β-D-allopyranose | β-D-allose mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%

Lewis structure

Draw the Lewis structure of D-allose. Start by drawing the overall structure of the molecule:  Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: |   |
Draw the Lewis structure of D-allose. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 180.16 g/mol phase | solid (at STP) melting point | 149 °C boiling point | 376 °C solubility in water | very soluble
molar mass | 180.16 g/mol phase | solid (at STP) melting point | 149 °C boiling point | 376 °C solubility in water | very soluble

Units

Hydrophobicity and permeability properties

predicted LogP hydrophobicity | -2.57 predicted LogS | 0.64
predicted LogP hydrophobicity | -2.57 predicted LogS | 0.64

Basic drug properties

approval status | experimental | small molecule
approval status | experimental | small molecule

Thermodynamic properties

specific heat capacity c_p | gas | 0.1998 J/(g K) molar heat capacity c_p | gas | 36 J/(mol K) specific heat of formation Δ_fH° | gas | 0.3636 kJ/g molar heat of formation Δ_fH° | gas | 65.5 kJ/mol (at STP)
specific heat capacity c_p | gas | 0.1998 J/(g K) molar heat capacity c_p | gas | 36 J/(mol K) specific heat of formation Δ_fH° | gas | 0.3636 kJ/g molar heat of formation Δ_fH° | gas | 65.5 kJ/mol (at STP)

Chemical identifiers

CAS number | 2595-97-3 Beilstein number | 1724623 PubChem CID number | 448388 PubChem SID number | 24857188 SMILES identifier | C(C1C(C(C(C(O1)O)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H, 1H2/t2-, 3-, 4-, 5-, 6-/m1/s1 InChI key | WQZGKKKJIJFFOK-UHFFFAOYAC MDL number | MFCD00063268
CAS number | 2595-97-3 Beilstein number | 1724623 PubChem CID number | 448388 PubChem SID number | 24857188 SMILES identifier | C(C1C(C(C(C(O1)O)O)O)O)O InChI identifier | InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H, 1H2/t2-, 3-, 4-, 5-, 6-/m1/s1 InChI key | WQZGKKKJIJFFOK-UHFFFAOYAC MDL number | MFCD00063268