Search

name of cesium oxalate

Input interpretation

cesium oxalate
cesium oxalate

Chemical names and formulas

formula | (COOCs)_2 Hill formula | C_2Cs_2O_4 name | cesium oxalate alternate names | cesium; ethanedioic acid | cesium; oxalic acid | oxalic acid cesium salt mass fractions | C (carbon) 6.79% | Cs (cesium) 75.1% | O (oxygen) 18.1%
formula | (COOCs)_2 Hill formula | C_2Cs_2O_4 name | cesium oxalate alternate names | cesium; ethanedioic acid | cesium; oxalic acid | oxalic acid cesium salt mass fractions | C (carbon) 6.79% | Cs (cesium) 75.1% | O (oxygen) 18.1%

Structure diagram

Structure diagram
Structure diagram
vertex count | 8 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
vertex count | 8 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993

Basic properties

molar mass | 353.829 g/mol
molar mass | 353.829 g/mol

Units

Chemical identifiers

CAS number | 1068-63-9 Beilstein number | 3709030 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cs+].[Cs+] MDL number | MFCD00054352
CAS number | 1068-63-9 Beilstein number | 3709030 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cs+].[Cs+] MDL number | MFCD00054352

Random Queries

CAS number of chromic chloride vs tin(IV) sulfide
volume magnetic susceptibility of carbon vs silicon
alcohols
ions of chlorine azide
density of sodium dithionite
molar mass of nitrogen(III) cation vs indium(III) cation
structure diagram of chlorine(I) cation vs fluoride anion
Cf-246 vs Lr-253
chemical types of 1,2-dichloropropane
discovery year of chromdravite vs sursassite