Search

InChI identifier of heptadecanoyl chloride vs benzoyl fluoride

Input interpretation

heptadecanoyl chloride benzoyl fluoride | InChI identifier
heptadecanoyl chloride benzoyl fluoride | InChI identifier

Results

heptadecanoyl chloride | InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3 benzoyl fluoride | InChI=1/C7H5FO/c8-7(9)6-4-2-1-3-5-6/h1-5H
heptadecanoyl chloride | InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3 benzoyl fluoride | InChI=1/C7H5FO/c8-7(9)6-4-2-1-3-5-6/h1-5H

Random Queries

Hill formula of sodium tetrachloroaurate(III) hydrate
ion class of oxygen(I) cation vs selenide anion
selenium vs krypton vs bromine vs rhodium
2, 4, 6-collidine
name of sodium hexachloroiridate(III) hydrate vs antimony(III) sulfide
half-life of Fm-259 vs Md-257
DOT numbers of 2-ethylhexanol vs esculetin
ZnOCO = ZnCO2
vertex count of manganese(II) chloride
calcium zirconate vs terbium(III) sulfate octahydrate