Search

InChI identifier of heptadecanoyl chloride vs benzoyl fluoride

Input interpretation

heptadecanoyl chloride benzoyl fluoride | InChI identifier
heptadecanoyl chloride benzoyl fluoride | InChI identifier

Results

heptadecanoyl chloride | InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3 benzoyl fluoride | InChI=1/C7H5FO/c8-7(9)6-4-2-1-3-5-6/h1-5H
heptadecanoyl chloride | InChI=1/C17H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2, 1H3 benzoyl fluoride | InChI=1/C7H5FO/c8-7(9)6-4-2-1-3-5-6/h1-5H

Random Queries

full symbol of electron capture
alternate names of chromium(II) cation vs oxide anion
molar mass of chlorine azide
formula of enfuvirtide
KMnO4 + CH2O = H2O + CO2 + K2CO3 + Mn
= H2CO3
freezing point of potassium selenocyanate vs dysprosium silicide
DOT hazard class of beryllium
alternate names of sodium bromate vs sodium fluoride
color of paracelsian vs odintsovite