Search

SMILES identifier of lead(II) nitrate

Input interpretation

lead(II) nitrate | SMILES identifier
lead(II) nitrate | SMILES identifier

Result

[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pb+2]
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pb+2]

Random Queries

molar mass of copper 8-quinolate
CAS number of potassium chromate vs magnesium carbonate dihydrate
cleavage of anorthite vs mcgillite
chemical uses copper(II) sulfate
most recent price of lanthanides
electrical conductivity of palladium vs silver
IUPAC name of pentafluoroethane
freezing point of dioxathion
atomic radius of strontium
name of beryllium cation vs barium cation