Search

InChI identifier of sodium carbonate decahydrate

Input interpretation

sodium carbonate decahydrate | InChI identifier
sodium carbonate decahydrate | InChI identifier

Result

InChI=1/CH2O3.2Na.10H2O/c2-1(3)4;;;;;;;;;;;;/h(H2, 2, 3, 4);;;10*1H2/q;2*+1;;;;;;;;;;/p-2/fCO3.2Na.10H2O/q-2;2m;;;;;;;;;;
InChI=1/CH2O3.2Na.10H2O/c2-1(3)4;;;;;;;;;;;;/h(H2, 2, 3, 4);;;10*1H2/q;2*+1;;;;;;;;;;/p-2/fCO3.2Na.10H2O/q-2;2m;;;;;;;;;;

Random Queries

InChI identifier of manganese(II) sulfate vs manganese(0) carbonyl
group of bismuth
O2 + K2CO3 + FeCr2O4 = CO2 + Fe2O3 + K2CrO4
CAS number of hydrogen fluoride vs hydrogen bromide
O2 + K + Cl2O7 = KClO4
acetyl vs benzoyl
InChI identifier of potassium bicarbonate
chemical types of erbium bromide hexahydrate
molar mass of 3-methylbenzylmagnesium chloride
chemical types of iodosyl trifluoride