Search

InChI identifier of D-(-)-fructose vs ethyl-trimethyl-silane

Input interpretation

D-(-)-fructose ethyl-trimethyl-silane | InChI identifier
D-(-)-fructose ethyl-trimethyl-silane | InChI identifier

Results

D-(-)-fructose | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1 ethyl-trimethyl-silane | InChI=1/C5H14Si/c1-5-6(2, 3)4/h5H2, 1-4H3
D-(-)-fructose | InChI=1/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5, 7-11H, 1-2H2/t3-, 4-, 5+, 6-/m1/s1 ethyl-trimethyl-silane | InChI=1/C5H14Si/c1-5-6(2, 3)4/h5H2, 1-4H3

Random Queries

molar mass of zinc nitrate hydrate
formula of 4,4-difluorocyclohexanecarboxylic acid
Fe2(SO4)3 + NH4OH = Fe(OH)3 + (NH4)2SO4
DOT numbers of heteronuclear diatomic molecules
price of nitrogen vs lithium
melting point of ammonium bicarbonate
(melting point of 1,1-diphenylethane)/(boiling point of 1,1-diphenylethane)
ion class of hexachloroplumbate(IV) anion vs hypomanganate anion
net ionic charge of stannite anion vs tin(II) cation
formula of magnesium sulfide vs manganese(IV) pyrophosphate