Search

InChI identifier of 1-phenylcyclohexene

Input interpretation

1-phenylcyclohexene | InChI identifier
1-phenylcyclohexene | InChI identifier

Result

InChI=1/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1, 3-4, 7-9H, 2, 5-6, 10H2
InChI=1/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1, 3-4, 7-9H, 2, 5-6, 10H2

Random Queries

chemical types of strontium hydride vs sodium bicarbonate
Mohs hardness of palladium vs kamacite
ion class of hexaaquamanganese(II) cation vs dicyanoaurate(I) anion
apply skeleton transform image awaruite
alternate names of carbon dioxide vs sulfuric acid
relative molecular mass of lithium fluoride
molar mass of bis(trimethylsilyl)amide anion
chemical types of vanadyl sulfate pentahydrate
ion class of xenon(IV) cation vs sulfide anion
chemical types of 4-iodophenyl isothiocyanate vs benzyl iodide