Search

name of magnesium perchlorate

Input interpretation

magnesium perchlorate
magnesium perchlorate

Chemical names and formulas

formula | Mg(ClO_4)_2 Hill formula | Cl_2MgO_8 name | magnesium perchlorate IUPAC name | magnesium diperchlorate alternate names | anhydrone | anhydrous magnesium perchlorate | dehydrite | perchloric acid magnesium salt mass fractions | Cl (chlorine) 31.8% | Mg (magnesium) 10.9% | O (oxygen) 57.3%
formula | Mg(ClO_4)_2 Hill formula | Cl_2MgO_8 name | magnesium perchlorate IUPAC name | magnesium diperchlorate alternate names | anhydrone | anhydrous magnesium perchlorate | dehydrite | perchloric acid magnesium salt mass fractions | Cl (chlorine) 31.8% | Mg (magnesium) 10.9% | O (oxygen) 57.3%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 223.2 g/mol phase | solid (at STP) melting point | 251 °C density | 2.21 g/cm^3
molar mass | 223.2 g/mol phase | solid (at STP) melting point | 251 °C density | 2.21 g/cm^3

Units

Solid properties (at STP)

density | 2.21 g/cm^3
density | 2.21 g/cm^3

Units

Chemical identifiers

CAS number | 10034-81-8 PubChem CID number | 24840 SMILES identifier | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Mg+2] InChI identifier | InChI=1/2ClHO4.Mg/c2*2-1(3, 4)5;/h2*(H, 2, 3, 4, 5);/q;;+2/p-2/f2ClO4.Mg/q2*-1;m EU number | 233-108-3 Gmelin number | 23306 RTECS number | SC8925000
CAS number | 10034-81-8 PubChem CID number | 24840 SMILES identifier | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Mg+2] InChI identifier | InChI=1/2ClHO4.Mg/c2*2-1(3, 4)5;/h2*(H, 2, 3, 4, 5);/q;;+2/p-2/f2ClO4.Mg/q2*-1;m EU number | 233-108-3 Gmelin number | 23306 RTECS number | SC8925000

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent

Toxicity properties

RTECS classes | other
RTECS classes | other

Ion equivalents

Mg^(2+) (magnesium cation) | 1 (ClO_4)^- (perchlorate anion) | 2
Mg^(2+) (magnesium cation) | 1 (ClO_4)^- (perchlorate anion) | 2