Search

SMILES identifier of beryllium fluoride vs 3-bromo-4-fluorocinnamic acid

Input interpretation

beryllium fluoride 3-bromo-4-fluorocinnamic acid | SMILES identifier
beryllium fluoride 3-bromo-4-fluorocinnamic acid | SMILES identifier

Results

beryllium fluoride | [Be+2].[F-].[F-] 3-bromo-4-fluorocinnamic acid | C1=CC(=C(C=C1C=CC(=O)O)Br)F
beryllium fluoride | [Be+2].[F-].[F-] 3-bromo-4-fluorocinnamic acid | C1=CC(=C(C=C1C=CC(=O)O)Br)F

Random Queries

CuSO4NH3 = [Cu(NH3)]SO4
DOT numbers of ammonium nitrate
ammonium bisulfate
IUPAC name of phosphorus tribromide vs beryllium bromide
chemical types of chlormequat
IUPAC name of bis(2-ethylhexyl)phthalate-3,4,5,6-d 4
chemical types of sodium amide vs hydrogen iodide
period 11 elements
decomposition point of 2-chloro-1-methylpyridinium iodide
SMILES identifier of barium hydroxide vs magnesium hydroxide