Search

SMILES identifier of beryllium fluoride vs 3-bromo-4-fluorocinnamic acid

Input interpretation

beryllium fluoride 3-bromo-4-fluorocinnamic acid | SMILES identifier
beryllium fluoride 3-bromo-4-fluorocinnamic acid | SMILES identifier

Results

beryllium fluoride | [Be+2].[F-].[F-] 3-bromo-4-fluorocinnamic acid | C1=CC(=C(C=C1C=CC(=O)O)Br)F
beryllium fluoride | [Be+2].[F-].[F-] 3-bromo-4-fluorocinnamic acid | C1=CC(=C(C=C1C=CC(=O)O)Br)F

Random Queries

beryllium oxide vs potassium nitrate-15 N,18 O3
turn into a comic an image of actinolite
HCl + FeCl2 + HNO2 = H2O + NO + FeCl3
melting point of liquid elements
IUPAC name of sodium bisulfide
chemical types of iron(III) oxide vs barium thiosulfate
nuclear radius of oxygen vs beryllium
boiling point of sodium bromide vs potassium chloride
structure diagram of bromate anion
melting point of 11-bromoundecanoic acid