Input interpretation
calcium chlorate
Chemical names and formulas
formula | CaCl_2O_6 name | calcium chlorate IUPAC name | calcium dichlorate alternate names | chloric acid calcium salt mass fractions | Ca (calcium) 19.4% | Cl (chlorine) 34.3% | O (oxygen) 46.4%
Structure diagram
Structure diagram
Basic properties
molar mass | 207 g/mol phase | solid (at STP) melting point | 325 °C density | 2.71 g/cm^3 solubility in water | soluble
Units
Solid properties (at STP)
density | 2.71 g/cm^3
Units
Chemical identifiers
![CAS number | 10137-74-3 PubChem CID number | 24978 SMILES identifier | [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Ca+2] InChI identifier | InChI=1/Ca.2ClHO3/c;2*2-1(3)4/h;2*(H, 2, 3, 4)/q+2;;/p-2/fCa.2ClO3/qm;2*-1 EU number | 233-378-2 Gmelin number | 34844 RTECS number | FN9800000](../image_source/ff1a79c3797f1b6d0527aaef30efe788.png)
CAS number | 10137-74-3 PubChem CID number | 24978 SMILES identifier | [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Ca+2] InChI identifier | InChI=1/Ca.2ClHO3/c;2*2-1(3)4/h;2*(H, 2, 3, 4)/q+2;;/p-2/fCa.2ClO3/qm;2*-1 EU number | 233-378-2 Gmelin number | 34844 RTECS number | FN9800000
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent
Toxicity properties
RTECS classes | agricultural chemical and pesticide