Search

InChI identifier of acetoxime

Input interpretation

acetoxime | InChI identifier
acetoxime | InChI identifier

Result

InChI=1/C3H7NO/c1-3(2)4-5/h5H, 1-2H3
InChI=1/C3H7NO/c1-3(2)4-5/h5H, 1-2H3

Random Queries

HCl + HNO3 + Ag = H2O + NO + AgCl
freezing point of 1,3-butadiene
ionic radius of silver(I) ions
name of molybdenum(I) cation vs ammonium cation
molar mass of isopropanol vs benzeneethanol, 3-methyl-
edge types of Arrhenius acids
IUPAC name of ethylene dichloride
O2 + NO2 = N2O5
molar mass of isobutane vs propadiene
IUPAC name of sodium hydride vs vanadium