Search

InChI identifier of L-tyrosine

Input interpretation

L-tyrosine | InChI identifier
L-tyrosine | InChI identifier

Result

InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4, 8, 11H, 5, 10H2, (H, 12, 13)/t8-/m0/s1/f/h12H
InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4, 8, 11H, 5, 10H2, (H, 12, 13)/t8-/m0/s1/f/h12H

Random Queries

chemical types of rhenium(VII) trioxyfluoride
magnetic type carbon
atomic diameter of carbon vs hydrogen
density of zinc vs nitrogen
chromic acid
H2SO4 + CrO3 = H2O + O2 + Cr2(SO4)3
NFPA fire rating of pyridine
HNO3 + AsH3 = H2O + NO2 + H3AsO4
IUPAC name of diocide
molar mass of copper(II) oxalate