Input interpretation
benzyl(S)-(-)-2-hydroxy-3-phenylpropionate
Chemical names and formulas
formula | C_6H_5CH_2CH(OH)CO_2CH_2C_6H_5 Hill formula | C_16H_16O_3 name | benzyl(S)-(-)-2-hydroxy-3-phenylpropionate IUPAC name | (2S)-2-hydroxy-3-phenylpropanoic acid phenylmethyl ester alternate names | (2S)-2-hydroxy-3-phenyl-propionic acid benzyl ester | phenylmethyl (2S)-2-hydroxy-3-phenyl-propanoate | phenylmethyl (2S)-2-hydroxy-3-phenylpropanoate mass fractions | C (carbon) 75% | H (hydrogen) 6.29% | O (oxygen) 18.7%
Lewis structure
Draw the Lewis structure of benzyl(S)-(-)-2-hydroxy-3-phenylpropionate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 16 n_C, val + 16 n_H, val + 3 n_O, val = 98 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 16 n_C, full + 16 n_H, full + 3 n_O, full = 184 Subtracting these two numbers shows that 184 - 98 = 86 bonding electrons are needed. Each bond has two electrons, so in addition to the 36 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 256.3 g/mol phase | liquid (at STP) boiling point | 288 °C density | 1.142 g/cm^3
Units
Liquid properties (at STP)
density | 1.142 g/cm^3 refractive index | 1.558
Units
Chemical identifiers
CAS number | 7622-21-1 PubChem CID number | 10377698 PubChem SID number | 24869613 SMILES identifier | C1=CC=C(C=C1)CC(C(=O)OCC2=CC=CC=C2)O InChI identifier | InChI=1/C16H16O3/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14/h1-10, 15, 17H, 11-12H2/t15-/m0/s1 MDL number | MFCD00274344
Safety properties
flash point | 110 °C