Search

name of soda ash vs ammonium hydroxide

Input interpretation

soda ash | ammonium hydroxide
soda ash | ammonium hydroxide

Chemical names and formulas

 | soda ash | ammonium hydroxide formula | Na_2CO_3 | NH_4OH Hill formula | CNa_2O_3 | H_5NO name | soda ash | ammonium hydroxide IUPAC name | disodium carbonate | ammonium hydroxide alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate | ammonia, aqua | ammonia, aqueous | ammonia aqueous | ammonia solution | ammonia water | aqua ammonia | aqueous ammonia | azanium hydroxide mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3% | H (hydrogen) 14.4% | N (nitrogen) 40% | O (oxygen) 45.7%
| soda ash | ammonium hydroxide formula | Na_2CO_3 | NH_4OH Hill formula | CNa_2O_3 | H_5NO name | soda ash | ammonium hydroxide IUPAC name | disodium carbonate | ammonium hydroxide alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate | ammonia, aqua | ammonia, aqueous | ammonia aqueous | ammonia solution | ammonia water | aqua ammonia | aqueous ammonia | azanium hydroxide mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3% | H (hydrogen) 14.4% | N (nitrogen) 40% | O (oxygen) 45.7%

Structure diagrams

Structure diagrams
Structure diagrams

Basic properties

 | soda ash | ammonium hydroxide molar mass | 105.99 g/mol | 35.046 g/mol phase | solid (at STP) | aqueous (at STP) melting point | 851 °C | -57.5 °C boiling point | 1600 °C | 36 °C density | | 0.9 g/cm^3 solubility in water | soluble | very soluble
| soda ash | ammonium hydroxide molar mass | 105.99 g/mol | 35.046 g/mol phase | solid (at STP) | aqueous (at STP) melting point | 851 °C | -57.5 °C boiling point | 1600 °C | 36 °C density | | 0.9 g/cm^3 solubility in water | soluble | very soluble

Units

Solid properties

 | soda ash refractive index | 1.495
| soda ash refractive index | 1.495

Chemical identifiers

 | soda ash | ammonium hydroxide CAS number | 497-19-8 | 1336-21-6 Beilstein number | 4154566 | 3587154 PubChem CID number | 10340 | 14923 PubChem SID number | 24852265 | 24859136 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] | [NH4+].[OH-] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m | InChI=1/H3N.H2O/h1H3;1H2/fH4N.HO/h1H;1h/q+1;-1 RTECS number | VZ4050000 |  MDL number | MFCD00003494 | MFCD00066650
| soda ash | ammonium hydroxide CAS number | 497-19-8 | 1336-21-6 Beilstein number | 4154566 | 3587154 PubChem CID number | 10340 | 14923 PubChem SID number | 24852265 | 24859136 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] | [NH4+].[OH-] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m | InChI=1/H3N.H2O/h1H3;1H2/fH4N.HO/h1H;1h/q+1;-1 RTECS number | VZ4050000 | MDL number | MFCD00003494 | MFCD00066650

NFPA label

NFPA label
NFPA label