Search

bromomethyl 4 trifluoromethyl benzene

Input interpretation

bromomethyl 4 trifluoromethyl benzene
bromomethyl 4 trifluoromethyl benzene

Basic properties

molar mass | 239 g/mol formula | C_8H_6BrF_3 empirical formula | Br_C_8F_3H_6 SMILES identifier | C1=C(C=CC(=C1)C(F)(F)F)CBr InChI identifier | InChI=1/C8H6BrF3/c9-5-6-1-3-7(4-2-6)8(10, 11)12/h1-4H, 5H2 InChI key | IKSNDOVDVVPSMA-UHFFFAOYSA-N
molar mass | 239 g/mol formula | C_8H_6BrF_3 empirical formula | Br_C_8F_3H_6 SMILES identifier | C1=C(C=CC(=C1)C(F)(F)F)CBr InChI identifier | InChI=1/C8H6BrF3/c9-5-6-1-3-7(4-2-6)8(10, 11)12/h1-4H, 5H2 InChI key | IKSNDOVDVVPSMA-UHFFFAOYSA-N

Lewis structure

Draw the Lewis structure of bromomethyl 4 trifluoromethyl benzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds:  Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), fluorine (n_F, val = 7), and hydrogen (n_H, val = 1) atoms: n_Br, val + 8 n_C, val + 3 n_F, val + 6 n_H, val = 66 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), fluorine (n_F, full = 8), and hydrogen (n_H, full = 2): n_Br, full + 8 n_C, full + 3 n_F, full + 6 n_H, full = 108 Subtracting these two numbers shows that 108 - 66 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom:  Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: |   |
Draw the Lewis structure of bromomethyl 4 trifluoromethyl benzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), fluorine (n_F, val = 7), and hydrogen (n_H, val = 1) atoms: n_Br, val + 8 n_C, val + 3 n_F, val + 6 n_H, val = 66 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), fluorine (n_F, full = 8), and hydrogen (n_H, full = 2): n_Br, full + 8 n_C, full + 3 n_F, full + 6 n_H, full = 108 Subtracting these two numbers shows that 108 - 66 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

Estimated thermodynamic properties

melting point | 9.7 °C boiling point | 201.7 °C critical temperature | 683.1 K critical pressure | 3.392 MPa critical volume | 480.5 cm^3/mol molar heat of vaporization | 39 kJ/mol molar heat of fusion | 17.23 kJ/mol molar enthalpy | -554.1 kJ/mol molar free energy | -448 kJ/mol (computed using the Joback method)
melting point | 9.7 °C boiling point | 201.7 °C critical temperature | 683.1 K critical pressure | 3.392 MPa critical volume | 480.5 cm^3/mol molar heat of vaporization | 39 kJ/mol molar heat of fusion | 17.23 kJ/mol molar enthalpy | -554.1 kJ/mol molar free energy | -448 kJ/mol (computed using the Joback method)

Units

Quantitative molecular descriptors

longest chain length | 8 atoms longest straight chain length | 3 atoms longest aliphatic chain length | 0 atoms aromatic atom count | 6 atoms H-bond acceptor count | 0 atoms H-bond donor count | 0 atoms
longest chain length | 8 atoms longest straight chain length | 3 atoms longest aliphatic chain length | 0 atoms aromatic atom count | 6 atoms H-bond acceptor count | 0 atoms H-bond donor count | 0 atoms

Elemental composition

Find the elemental composition for bromomethyl 4 trifluoromethyl benzene in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_8H_6BrF_3 Use the chemical formula, C_8H_6BrF_3, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms:  | number of atoms  Br (bromine) | 1  C (carbon) | 8  F (fluorine) | 3  H (hydrogen) | 6  N_atoms = 1 + 8 + 3 + 6 = 18 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work:  | number of atoms | atom fraction  Br (bromine) | 1 | 1/18  C (carbon) | 8 | 8/18  F (fluorine) | 3 | 3/18  H (hydrogen) | 6 | 6/18 Check: 1/18 + 8/18 + 3/18 + 6/18 = 1 Compute atom percents using the atom fractions:  | number of atoms | atom percent  Br (bromine) | 1 | 1/18 × 100% = 5.56%  C (carbon) | 8 | 8/18 × 100% = 44.4%  F (fluorine) | 3 | 3/18 × 100% = 16.7%  H (hydrogen) | 6 | 6/18 × 100% = 33.3% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table:  | number of atoms | atom percent | atomic mass/u  Br (bromine) | 1 | 5.56% | 79.904  C (carbon) | 8 | 44.4% | 12.011  F (fluorine) | 3 | 16.7% | 18.998403163  H (hydrogen) | 6 | 33.3% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m:  | number of atoms | atom percent | atomic mass/u | mass/u  Br (bromine) | 1 | 5.56% | 79.904 | 1 × 79.904 = 79.904  C (carbon) | 8 | 44.4% | 12.011 | 8 × 12.011 = 96.088  F (fluorine) | 3 | 16.7% | 18.998403163 | 3 × 18.998403163 = 56.995209489  H (hydrogen) | 6 | 33.3% | 1.008 | 6 × 1.008 = 6.048  m = 79.904 u + 96.088 u + 56.995209489 u + 6.048 u = 239.035209489 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work:  | number of atoms | atom percent | mass fraction  Br (bromine) | 1 | 5.56% | 79.904/239.035209489  C (carbon) | 8 | 44.4% | 96.088/239.035209489  F (fluorine) | 3 | 16.7% | 56.995209489/239.035209489  H (hydrogen) | 6 | 33.3% | 6.048/239.035209489 Check: 79.904/239.035209489 + 96.088/239.035209489 + 56.995209489/239.035209489 + 6.048/239.035209489 = 1 Compute mass percents using the mass fractions: Answer: |   | | number of atoms | atom percent | mass percent  Br (bromine) | 1 | 5.56% | 79.904/239.035209489 × 100% = 33.43%  C (carbon) | 8 | 44.4% | 96.088/239.035209489 × 100% = 40.20%  F (fluorine) | 3 | 16.7% | 56.995209489/239.035209489 × 100% = 23.84%  H (hydrogen) | 6 | 33.3% | 6.048/239.035209489 × 100% = 2.530%
Find the elemental composition for bromomethyl 4 trifluoromethyl benzene in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_8H_6BrF_3 Use the chemical formula, C_8H_6BrF_3, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms: | number of atoms Br (bromine) | 1 C (carbon) | 8 F (fluorine) | 3 H (hydrogen) | 6 N_atoms = 1 + 8 + 3 + 6 = 18 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Br (bromine) | 1 | 1/18 C (carbon) | 8 | 8/18 F (fluorine) | 3 | 3/18 H (hydrogen) | 6 | 6/18 Check: 1/18 + 8/18 + 3/18 + 6/18 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Br (bromine) | 1 | 1/18 × 100% = 5.56% C (carbon) | 8 | 8/18 × 100% = 44.4% F (fluorine) | 3 | 3/18 × 100% = 16.7% H (hydrogen) | 6 | 6/18 × 100% = 33.3% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Br (bromine) | 1 | 5.56% | 79.904 C (carbon) | 8 | 44.4% | 12.011 F (fluorine) | 3 | 16.7% | 18.998403163 H (hydrogen) | 6 | 33.3% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Br (bromine) | 1 | 5.56% | 79.904 | 1 × 79.904 = 79.904 C (carbon) | 8 | 44.4% | 12.011 | 8 × 12.011 = 96.088 F (fluorine) | 3 | 16.7% | 18.998403163 | 3 × 18.998403163 = 56.995209489 H (hydrogen) | 6 | 33.3% | 1.008 | 6 × 1.008 = 6.048 m = 79.904 u + 96.088 u + 56.995209489 u + 6.048 u = 239.035209489 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Br (bromine) | 1 | 5.56% | 79.904/239.035209489 C (carbon) | 8 | 44.4% | 96.088/239.035209489 F (fluorine) | 3 | 16.7% | 56.995209489/239.035209489 H (hydrogen) | 6 | 33.3% | 6.048/239.035209489 Check: 79.904/239.035209489 + 96.088/239.035209489 + 56.995209489/239.035209489 + 6.048/239.035209489 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Br (bromine) | 1 | 5.56% | 79.904/239.035209489 × 100% = 33.43% C (carbon) | 8 | 44.4% | 96.088/239.035209489 × 100% = 40.20% F (fluorine) | 3 | 16.7% | 56.995209489/239.035209489 × 100% = 23.84% H (hydrogen) | 6 | 33.3% | 6.048/239.035209489 × 100% = 2.530%

Elemental oxidation states

The first step in finding the oxidation states (or oxidation numbers) in bromomethyl 4 trifluoromethyl benzene is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge:  In bromomethyl 4 trifluoromethyl benzene hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond:  With hydrogen out of the way, look at the remaining bonds. There are 1 bromine-carbon bond, 3 carbon-fluorine bonds, and 8 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element.  First examine the bromine-carbon bond: element | electronegativity (Pauling scale) |  Br | 2.96 |  C | 2.55 |   | |  Since bromine is more electronegative than carbon, the electrons in this bond will go to bromine. Decrease the oxidation number for bromine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly:  Next look at the carbon-fluorine bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  F | 3.98 |   | |  Since fluorine is more electronegative than carbon, the electrons in these bonds will go to fluorine:  Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  C | 2.55 |   | |  Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states:  Now summarize the results: Answer: |   | oxidation state | element | count  -1 | Br (bromine) | 1  | C (carbon) | 5  | F (fluorine) | 3  0 | C (carbon) | 2  +1 | H (hydrogen) | 6  +3 | C (carbon) | 1
The first step in finding the oxidation states (or oxidation numbers) in bromomethyl 4 trifluoromethyl benzene is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In bromomethyl 4 trifluoromethyl benzene hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 bromine-carbon bond, 3 carbon-fluorine bonds, and 8 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the bromine-carbon bond: element | electronegativity (Pauling scale) | Br | 2.96 | C | 2.55 | | | Since bromine is more electronegative than carbon, the electrons in this bond will go to bromine. Decrease the oxidation number for bromine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-fluorine bonds: element | electronegativity (Pauling scale) | C | 2.55 | F | 3.98 | | | Since fluorine is more electronegative than carbon, the electrons in these bonds will go to fluorine: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -1 | Br (bromine) | 1 | C (carbon) | 5 | F (fluorine) | 3 0 | C (carbon) | 2 +1 | H (hydrogen) | 6 +3 | C (carbon) | 1

Orbital hybridization

First draw the structure diagram for bromomethyl 4 trifluoromethyl benzene, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds:  Identify those atoms with lone pairs:  Find the steric number by adding the lone pair count to the number of σ-bonds:  Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: |   |
First draw the structure diagram for bromomethyl 4 trifluoromethyl benzene, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |

Topological indices

vertex count | 18 edge count | 18 Schultz index | 2016 Wiener index | 525 Hosoya index | 1713 Balaban index | 3.113
vertex count | 18 edge count | 18 Schultz index | 2016 Wiener index | 525 Hosoya index | 1713 Balaban index | 3.113