Search

InChI identifier of tetradecanoyl chloride vs 4-fluoro-2-isopropoxyphenylboronic acid

Input interpretation

tetradecanoyl chloride 4-fluoro-2-isopropoxyphenylboronic acid | InChI identifier
tetradecanoyl chloride 4-fluoro-2-isopropoxyphenylboronic acid | InChI identifier

Results

tetradecanoyl chloride | InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3 4-fluoro-2-isopropoxyphenylboronic acid | InChI=1/C9H12BFO3/c1-6(2)14-9-5-7(11)3-4-8(9)10(12)13/h3-6, 12-13H, 1-2H3
tetradecanoyl chloride | InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2, 1H3 4-fluoro-2-isopropoxyphenylboronic acid | InChI=1/C9H12BFO3/c1-6(2)14-9-5-7(11)3-4-8(9)10(12)13/h3-6, 12-13H, 1-2H3

Random Queries

non-standard isotope numbers of thorium(IV) oxide
mass magnetic susceptibility of indium vs thallium
refractive indices of beryl vs ferrosilite
van der Waals radius silver
CaSO4 + Ba(NO3)2 = BaSO4 + Ca(NO3)2
DOT hazard class of beryllium oxide
molar mass of aluminum bromate nonahydrate vs uranyl nitrate
alternate names of aegirine
Na2CO3 + SiO2 = CO2 + Na4SiO4
IUPAC name of silicon