Input interpretation
5-chloro-2-fluorophenylboronic acid
Chemical names and formulas
formula | ClC_6H_3(F)B(OH)_2 Hill formula | C_6H_5BClFO_2 name | 5-chloro-2-fluorophenylboronic acid IUPAC name | (5-chloro-2-fluorophenyl)boronic acid alternate names | (5-chloro-2-fluoro-phenyl)boronic acid | (5-chloro-2-fluorophenyl)boronic acid mass fractions | B (boron) 6.2% | C (carbon) 41.3% | Cl (chlorine) 20.3% | F (fluorine) 10.9% | H (hydrogen) 2.89% | O (oxygen) 18.4%
Lewis structure
Draw the Lewis structure of 5-chloro-2-fluorophenylboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), chlorine (n_Cl, val = 7), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + 6 n_C, val + n_Cl, val + n_F, val + 5 n_H, val + 2 n_O, val = 58 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), chlorine (n_Cl, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + 6 n_C, full + n_Cl, full + n_F, full + 5 n_H, full + 2 n_O, full = 96 Subtracting these two numbers shows that 96 - 58 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 16 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
Basic properties
molar mass | 174.4 g/mol phase | solid (at STP) melting point | 124.5 °C
Units
Chemical identifiers
CAS number | 352535-83-2 PubChem CID number | 3718925 PubChem SID number | 24879654 SMILES identifier | B(C1=C(C=CC(=C1)Cl)F)(O)O InChI identifier | InChI=1/C6H5BClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3, 10-11H MDL number | MFCD05664225