Search

InChI identifier of aurothioglucose

Input interpretation

aurothioglucose | InChI identifier
aurothioglucose | InChI identifier

Result

InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m
InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m

Random Queries

vertex count of methyl chloride
(atomic radius of sulfur)/(nuclear radius of sulfur)
chemical functional groups of 2,2,2-trifluoroethyl trifluoroacetate
color of fresnoite
long-term exposure limit of polar aprotic solvents
IUPAC name of deuterated phosphine
IUPAC holmium chloride
molar mass of 2-(trifluoromethoxy)iodobenzene
atomic mass of period 6 elements
mass fractions of hydrogen fluoride