Search

InChI identifier of aurothioglucose

Input interpretation

aurothioglucose | InChI identifier
aurothioglucose | InChI identifier

Result

InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m
InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m

Random Queries

alternate names of 1-(trimethylsilyl)-1-propyne
apply commonest filter image taramellite
atomic number of tantalum vs vanadium
atomic mass of iodine
group of krypton
HNO3 + Cu = H2O + NO + NO3
chemical types hydrogen iodide
name of beryl
lattice schematic of thallium
KI + Fe2(SO4)3 = K2SO4 + I2 + FeSO4