Search

name of benzyltriphenylphosphonium chloride

Input interpretation

benzyltriphenylphosphonium chloride
benzyltriphenylphosphonium chloride

Chemical names and formulas

formula | C_6H_5CH_2P(Cl)(C_6H_5)_3 Hill formula | C_25H_22ClP name | benzyltriphenylphosphonium chloride IUPAC name | benzyl-triphenylphosphonium chloride alternate names | benzyl-triphenylphosphanium chloride | benzyltriphenylphosphonide chloride | benzyl-triphenyl-phosphonium chloride | phosphonium, benzyltriphenyl, chloride | triphenylbenzylphosphonium chloride | triphenyl-(phenylmethyl)phosphanium chloride | triphenyl(phenylmethyl)phosphonium chloride mass fractions | C (carbon) 77.2% | Cl (chlorine) 9.12% | H (hydrogen) 5.7% | P (phosphorus) 7.96%
formula | C_6H_5CH_2P(Cl)(C_6H_5)_3 Hill formula | C_25H_22ClP name | benzyltriphenylphosphonium chloride IUPAC name | benzyl-triphenylphosphonium chloride alternate names | benzyl-triphenylphosphanium chloride | benzyltriphenylphosphonide chloride | benzyl-triphenyl-phosphonium chloride | phosphonium, benzyltriphenyl, chloride | triphenylbenzylphosphonium chloride | triphenyl-(phenylmethyl)phosphanium chloride | triphenyl(phenylmethyl)phosphonium chloride mass fractions | C (carbon) 77.2% | Cl (chlorine) 9.12% | H (hydrogen) 5.7% | P (phosphorus) 7.96%

Structure diagram

Structure diagram
Structure diagram
vertex count | 27 edge count | 29 Schultz index | 6370 Wiener index | 1441 Hosoya index | 458784 Balaban index | 1.639
vertex count | 27 edge count | 29 Schultz index | 6370 Wiener index | 1441 Hosoya index | 458784 Balaban index | 1.639

Basic properties

molar mass | 388.87 g/mol phase | solid (at STP) melting point | 300 °C solubility in water | soluble
molar mass | 388.87 g/mol phase | solid (at STP) melting point | 300 °C solubility in water | soluble

Units

Chemical identifiers

CAS number | 1100-88-5 Beilstein number | 3599868 PubChem CID number | 70671 PubChem SID number | 24891707 SMILES identifier | C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] InChI identifier | InChI=1/C25H22P.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23, 24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H, 21H2;1H/q+1;/p-1/fC25H22P.Cl/h;1h/qm;-1 RTECS number | TA2416500 MDL number | MFCD00011913
CAS number | 1100-88-5 Beilstein number | 3599868 PubChem CID number | 70671 PubChem SID number | 24891707 SMILES identifier | C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] InChI identifier | InChI=1/C25H22P.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23, 24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H, 21H2;1H/q+1;/p-1/fC25H22P.Cl/h;1h/qm;-1 RTECS number | TA2416500 MDL number | MFCD00011913

Safety properties

flash point | 300 °C
flash point | 300 °C
DOT numbers | 3278
DOT numbers | 3278

Toxicity properties

RTECS classes | other
RTECS classes | other