Search

InChI identifier of undecanoyl chloride

Input interpretation

undecanoyl chloride | InChI identifier
undecanoyl chloride | InChI identifier

Result

InChI=1/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2, 1H3
InChI=1/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2, 1H3

Random Queries

density of ammonium nitrate vs sodium sulfate
S + HI = I2 + H2S
formula string of fluoride anion
element strong
Cf-237 vs Po-192
melting point of molybdenum vs cadmium
cv of an ideal gas 1 mole diatomic gas
molar mass of 2,5-dibromo-3-decylthiophene
density of borane isoamylsulfide complex vs silver(I) selenate
ion class of tin(II) cation vs copper(II) cation