Search

InChI identifier of undecanoyl chloride

Input interpretation

undecanoyl chloride | InChI identifier
undecanoyl chloride | InChI identifier

Result

InChI=1/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2, 1H3
InChI=1/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2, 1H3

Random Queries

group of chromium vs zinc
DOT numbers of sodium metavanadate
chemical types of cesium dichromate vs potassium tantalate
total number of electrons of oxygen(I) cation vs polonium(II) cation
calcium cation vs magnesium cation vs cadmium cation
electrical conductivities of liquid elements
chemical uses of L-arginine vs catechol
formula of 2-tricosanone
chemical types of glycerol
alternate names of rubidium hydroxide vs lime