Input interpretation
![4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane](../image_source/8c9d39bc07b08942040f105270f6aca7.png)
4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane
Basic properties
![molar mass | 150.6 g/mol formula | C_6H_11ClO_2 empirical formula | Cl_C_6O_2H_11 SMILES identifier | CC1(C)OCC(CCl)O1 InChI identifier | InChI=1/C6H11ClO2/c1-6(2)8-4-5(3-7)9-6/h5H, 3-4H2, 1-2H3 InChI key | BNPOTXLWPZOESZ-UHFFFAOYSA-N](../image_source/c3685b7dfec06cd8ac397f7cfa14eb40.png)
molar mass | 150.6 g/mol formula | C_6H_11ClO_2 empirical formula | Cl_C_6O_2H_11 SMILES identifier | CC1(C)OCC(CCl)O1 InChI identifier | InChI=1/C6H11ClO2/c1-6(2)8-4-5(3-7)9-6/h5H, 3-4H2, 1-2H3 InChI key | BNPOTXLWPZOESZ-UHFFFAOYSA-N
Lewis structure
![Draw the Lewis structure of 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + n_Cl, val + 11 n_H, val + 2 n_O, val = 54 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + n_Cl, full + 11 n_H, full + 2 n_O, full = 94 Subtracting these two numbers shows that 94 - 54 = 40 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 20 bonds and hence 40 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 54 - 40 = 14 electrons left to draw: Answer: | |](../image_source/fd67fce4eb82fb91a7da8fa37814b4d5.png)
Draw the Lewis structure of 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + n_Cl, val + 11 n_H, val + 2 n_O, val = 54 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + n_Cl, full + 11 n_H, full + 2 n_O, full = 94 Subtracting these two numbers shows that 94 - 54 = 40 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 20 bonds and hence 40 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 54 - 40 = 14 electrons left to draw: Answer: | |
Estimated thermodynamic properties
![melting point | -2.15 °C boiling point | 165.7 °C critical temperature | 651.9 K critical pressure | 3.642 MPa critical volume | 400.5 cm^3/mol molar heat of vaporization | 41.1 kJ/mol molar heat of fusion | 20.16 kJ/mol molar enthalpy | -391.5 kJ/mol molar free energy | -161.2 kJ/mol (computed using the Joback method)](../image_source/4b46f160fde2b2e510591eadacb2c508.png)
melting point | -2.15 °C boiling point | 165.7 °C critical temperature | 651.9 K critical pressure | 3.642 MPa critical volume | 400.5 cm^3/mol molar heat of vaporization | 41.1 kJ/mol molar heat of fusion | 20.16 kJ/mol molar enthalpy | -391.5 kJ/mol molar free energy | -161.2 kJ/mol (computed using the Joback method)
Units
Quantitative molecular descriptors
![longest chain length | 6 atoms longest straight chain length | 2 atoms longest aliphatic chain length | 0 atoms aromatic atom count | 0 atoms H-bond acceptor count | 2 atoms H-bond donor count | 0 atoms](../image_source/602e6f70dd8f434632b87c8644256365.png)
longest chain length | 6 atoms longest straight chain length | 2 atoms longest aliphatic chain length | 0 atoms aromatic atom count | 0 atoms H-bond acceptor count | 2 atoms H-bond donor count | 0 atoms
Elemental composition
![Find the elemental composition for 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_6H_11ClO_2 Use the chemical formula, C_6H_11ClO_2, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms: | number of atoms Cl (chlorine) | 1 C (carbon) | 6 O (oxygen) | 2 H (hydrogen) | 11 N_atoms = 1 + 6 + 2 + 11 = 20 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Cl (chlorine) | 1 | 1/20 C (carbon) | 6 | 6/20 O (oxygen) | 2 | 2/20 H (hydrogen) | 11 | 11/20 Check: 1/20 + 6/20 + 2/20 + 11/20 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Cl (chlorine) | 1 | 1/20 × 100% = 5.00% C (carbon) | 6 | 6/20 × 100% = 30.0% O (oxygen) | 2 | 2/20 × 100% = 10.00% H (hydrogen) | 11 | 11/20 × 100% = 55.0% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Cl (chlorine) | 1 | 5.00% | 35.45 C (carbon) | 6 | 30.0% | 12.011 O (oxygen) | 2 | 10.00% | 15.999 H (hydrogen) | 11 | 55.0% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Cl (chlorine) | 1 | 5.00% | 35.45 | 1 × 35.45 = 35.45 C (carbon) | 6 | 30.0% | 12.011 | 6 × 12.011 = 72.066 O (oxygen) | 2 | 10.00% | 15.999 | 2 × 15.999 = 31.998 H (hydrogen) | 11 | 55.0% | 1.008 | 11 × 1.008 = 11.088 m = 35.45 u + 72.066 u + 31.998 u + 11.088 u = 150.602 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Cl (chlorine) | 1 | 5.00% | 35.45/150.602 C (carbon) | 6 | 30.0% | 72.066/150.602 O (oxygen) | 2 | 10.00% | 31.998/150.602 H (hydrogen) | 11 | 55.0% | 11.088/150.602 Check: 35.45/150.602 + 72.066/150.602 + 31.998/150.602 + 11.088/150.602 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Cl (chlorine) | 1 | 5.00% | 35.45/150.602 × 100% = 23.54% C (carbon) | 6 | 30.0% | 72.066/150.602 × 100% = 47.85% O (oxygen) | 2 | 10.00% | 31.998/150.602 × 100% = 21.25% H (hydrogen) | 11 | 55.0% | 11.088/150.602 × 100% = 7.362%](../image_source/1006a144fe047f61f335aa4379049411.png)
Find the elemental composition for 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_6H_11ClO_2 Use the chemical formula, C_6H_11ClO_2, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms: | number of atoms Cl (chlorine) | 1 C (carbon) | 6 O (oxygen) | 2 H (hydrogen) | 11 N_atoms = 1 + 6 + 2 + 11 = 20 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Cl (chlorine) | 1 | 1/20 C (carbon) | 6 | 6/20 O (oxygen) | 2 | 2/20 H (hydrogen) | 11 | 11/20 Check: 1/20 + 6/20 + 2/20 + 11/20 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Cl (chlorine) | 1 | 1/20 × 100% = 5.00% C (carbon) | 6 | 6/20 × 100% = 30.0% O (oxygen) | 2 | 2/20 × 100% = 10.00% H (hydrogen) | 11 | 11/20 × 100% = 55.0% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Cl (chlorine) | 1 | 5.00% | 35.45 C (carbon) | 6 | 30.0% | 12.011 O (oxygen) | 2 | 10.00% | 15.999 H (hydrogen) | 11 | 55.0% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Cl (chlorine) | 1 | 5.00% | 35.45 | 1 × 35.45 = 35.45 C (carbon) | 6 | 30.0% | 12.011 | 6 × 12.011 = 72.066 O (oxygen) | 2 | 10.00% | 15.999 | 2 × 15.999 = 31.998 H (hydrogen) | 11 | 55.0% | 1.008 | 11 × 1.008 = 11.088 m = 35.45 u + 72.066 u + 31.998 u + 11.088 u = 150.602 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Cl (chlorine) | 1 | 5.00% | 35.45/150.602 C (carbon) | 6 | 30.0% | 72.066/150.602 O (oxygen) | 2 | 10.00% | 31.998/150.602 H (hydrogen) | 11 | 55.0% | 11.088/150.602 Check: 35.45/150.602 + 72.066/150.602 + 31.998/150.602 + 11.088/150.602 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Cl (chlorine) | 1 | 5.00% | 35.45/150.602 × 100% = 23.54% C (carbon) | 6 | 30.0% | 72.066/150.602 × 100% = 47.85% O (oxygen) | 2 | 10.00% | 31.998/150.602 × 100% = 21.25% H (hydrogen) | 11 | 55.0% | 11.088/150.602 × 100% = 7.362%
Elemental oxidation states
![The first step in finding the oxidation states (or oxidation numbers) in 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 carbon-chlorine bond, 4 carbon-oxygen bonds, and 4 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-chlorine bond: element | electronegativity (Pauling scale) | C | 2.55 | Cl | 3.16 | | | Since chlorine is more electronegative than carbon, the electrons in this bond will go to chlorine. Decrease the oxidation number for chlorine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-oxygen bonds: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | C (carbon) | 2 -2 | O (oxygen) | 2 -1 | C (carbon) | 2 | Cl (chlorine) | 1 0 | C (carbon) | 1 +1 | H (hydrogen) | 11 +2 | C (carbon) | 1](../image_source/14b4e2056acdbcef45cda7a4583d4529.png)
The first step in finding the oxidation states (or oxidation numbers) in 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 carbon-chlorine bond, 4 carbon-oxygen bonds, and 4 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-chlorine bond: element | electronegativity (Pauling scale) | C | 2.55 | Cl | 3.16 | | | Since chlorine is more electronegative than carbon, the electrons in this bond will go to chlorine. Decrease the oxidation number for chlorine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-oxygen bonds: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | C (carbon) | 2 -2 | O (oxygen) | 2 -1 | C (carbon) | 2 | Cl (chlorine) | 1 0 | C (carbon) | 1 +1 | H (hydrogen) | 11 +2 | C (carbon) | 1
Orbital hybridization
![First draw the structure diagram for 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |](../image_source/41ec0d78493b9a224162aca32414a48c.png)
First draw the structure diagram for 4-(chloromethyl)-2, 2-dimethyl-1, 3-dioxolane, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |
Topological indices
![vertex count | 20 edge count | 20 Schultz index | 2452 Wiener index | 647 Hosoya index | 2672 Balaban index | 3.518](../image_source/c51482d07fa88217ca6a93d384901678.png)
vertex count | 20 edge count | 20 Schultz index | 2452 Wiener index | 647 Hosoya index | 2672 Balaban index | 3.518