Search

SMILES identifier of 1,2,3-trichloro-5-(trifluoromethyl)benzene

Input interpretation

1, 2, 3-trichloro-5-(trifluoromethyl)benzene | SMILES identifier
1, 2, 3-trichloro-5-(trifluoromethyl)benzene | SMILES identifier

Result

C1=C(C=C(C(=C1Cl)Cl)Cl)C(F)(F)F
C1=C(C=C(C(=C1Cl)Cl)Cl)C(F)(F)F

Random Queries

magnesium nitride
H2O + FeCl3 + K2CO3 = CO2 + KCl + Fe(OH)3
chemical types of rubidium sulfate vs 2-benzyloxy-1-methylpyridinium triflate
electronegativity of lead vs praseodymium
NaOH + KClO3 + CrCl3 = H2O + NaCl + KCl + Na2CrO4
create a sepia image andesine
CAS number of copper(I) acetylide vs thallium(III) perchlorate hydrate
PubChem SID number of aluminum fluoride trihydrate
alternate names of 3-bromobenzylmagnesium bromide vs 2,6-dibromo-4-nitrophenol
ions of bismuth acetate