Input interpretation
![mechlorethamine hydrochloride](../image_source/948a1a3a316c85f27babda8624201161.png)
mechlorethamine hydrochloride
Chemical names and formulas
![formula | (ClCH_2CH_2)_2NCH_3·HCl Hill formula | C_5H_12Cl_3N name | mechlorethamine hydrochloride IUPAC name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride alternate names | 2-chloro-N-(2-chloroethyl)-N-methylethanamine | 2-chloro-N-(2-chloroethyl)-N-methyl-ethanamine hydrochloride | 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride | bis(2-chloroethyl)methylamine | bis(2-chloroethyl)-methyl-amine hydrochloride | N-methylbis(2-chloroethyl)amine hydrochloride mass fractions | C (carbon) 31.2% | Cl (chlorine) 55.2% | H (hydrogen) 6.28% | N (nitrogen) 7.28%](../image_source/3b13b5e2f1d81ceee1e5fefd070e486c.png)
formula | (ClCH_2CH_2)_2NCH_3·HCl Hill formula | C_5H_12Cl_3N name | mechlorethamine hydrochloride IUPAC name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride alternate names | 2-chloro-N-(2-chloroethyl)-N-methylethanamine | 2-chloro-N-(2-chloroethyl)-N-methyl-ethanamine hydrochloride | 2-chloro-N-(2-chloroethyl)-N-methylethanamine hydrochloride | bis(2-chloroethyl)methylamine | bis(2-chloroethyl)-methyl-amine hydrochloride | N-methylbis(2-chloroethyl)amine hydrochloride mass fractions | C (carbon) 31.2% | Cl (chlorine) 55.2% | H (hydrogen) 6.28% | N (nitrogen) 7.28%
Structure diagram
![Structure diagram](../image_source/6af46f3bc0a9ed1a4b7a6e429268c27a.png)
Structure diagram
Basic properties
![molar mass | 192.5 g/mol phase | solid (at STP) melting point | 109.5 °C](../image_source/c8cb52914e77ba05fc91063068089c71.png)
molar mass | 192.5 g/mol phase | solid (at STP) melting point | 109.5 °C
Units
Hydrophobicity and permeability properties
![experimental LogP hydrophobicity | 1.6 predicted LogP hydrophobicity | 1.31 predicted LogS | -0.67](../image_source/495a82908b2693be36bc92668f198239.png)
experimental LogP hydrophobicity | 1.6 predicted LogP hydrophobicity | 1.31 predicted LogS | -0.67
Basic drug properties
![approval status | approved | small molecule drug categories | alkylating agent | alkylating antineoplastic agent | chemical warfare agent | irritant dosage forms | intravenous: injection, powder, for solution | topical: powder](../image_source/017b5b421af8e09393447f175f353d1d.png)
approval status | approved | small molecule drug categories | alkylating agent | alkylating antineoplastic agent | chemical warfare agent | irritant dosage forms | intravenous: injection, powder, for solution | topical: powder
![brand names | caryolysin | caryolysine | cloramin | dichloren | embichin | mustargen | mutagen](../image_source/1de1e506f75b3596e656b43a9f56aa92.png)
brand names | caryolysin | caryolysine | cloramin | dichloren | embichin | mustargen | mutagen
Chemical identifiers
![CAS number | 55-86-7 PubChem CID number | 5935 PubChem SID number | 24847496 SMILES identifier | CN(CCCl)CCCl.Cl InChI identifier | InChI=1/C5H11Cl2N.ClH/c1-8(4-2-6)5-3-7;/h2-5H2, 1H3;1H InChI key | HAWPXGHAZFHHAD-UHFFFAOYAG RTECS number | IA2100000 MDL number | MFCD00012517](../image_source/2cf93f4e1385fa5ba4a6e92bb2eb8d07.png)
CAS number | 55-86-7 PubChem CID number | 5935 PubChem SID number | 24847496 SMILES identifier | CN(CCCl)CCCl.Cl InChI identifier | InChI=1/C5H11Cl2N.ClH/c1-8(4-2-6)5-3-7;/h2-5H2, 1H3;1H InChI key | HAWPXGHAZFHHAD-UHFFFAOYAG RTECS number | IA2100000 MDL number | MFCD00012517