Input interpretation
potassium acetate
Chemical names and formulas
formula | CH_3COOK Hill formula | C_2H_3KO_2 name | potassium acetate alternate names | acetic acid, potassium salt | acetic acid potassium salt | diuretic salt | K(acac) | potassium ethanoate mass fractions | C (carbon) 24.5% | H (hydrogen) 3.08% | K (potassium) 39.8% | O (oxygen) 32.6%
Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
Basic properties
molar mass | 98.142 g/mol phase | solid (at STP) melting point | 304 °C density | 1.57 g/cm^3
Units
Solid properties (at STP)
density | 1.57 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 7.65 kJ/mol specific heat of fusion | 0.0779 kJ/g (at STP)
Chemical identifiers
![CAS number | 127-08-2 Beilstein number | 3595449 PubChem CID number | 517044 SMILES identifier | CC(=O)[O-].[K+] InChI identifier | InChI=1/C2H4O2.K/c1-2(3)4;/h1H3, (H, 3, 4);/q;+1/p-1/fC2H3O2.K/q-1;m RTECS number | AJ3325000 MDL number | MFCD00012458](../image_source/f7b6decc09a44580f2a50a8207891224.png)
CAS number | 127-08-2 Beilstein number | 3595449 PubChem CID number | 517044 SMILES identifier | CC(=O)[O-].[K+] InChI identifier | InChI=1/C2H4O2.K/c1-2(3)4;/h1H3, (H, 3, 4);/q;+1/p-1/fC2H3O2.K/q-1;m RTECS number | AJ3325000 MDL number | MFCD00012458
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
RTECS classes | other
Ion equivalents
K^+ (potassium cation) | 1 (CH_3CO_2)^- (acetate anion) | 1