Search

DOT antimony pentachloride

Input interpretation

sodium bromate | antimony pentachloride
sodium bromate | antimony pentachloride

Chemical names and formulas

 | sodium bromate | antimony pentachloride formula | NaBrO_3 | SbCl_5 Hill formula | BrNaO_3 | Cl_5Sb name | sodium bromate | antimony pentachloride IUPAC name | sodium bromate | pentachlorostiborane alternate names | DOT | dyetone | antimony chloride | antimony perchloride | antimony(V) chloride | pentachlorostiborane mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Cl (chlorine) 59.3% | Sb (antimony) 40.7%
| sodium bromate | antimony pentachloride formula | NaBrO_3 | SbCl_5 Hill formula | BrNaO_3 | Cl_5Sb name | sodium bromate | antimony pentachloride IUPAC name | sodium bromate | pentachlorostiborane alternate names | DOT | dyetone | antimony chloride | antimony perchloride | antimony(V) chloride | pentachlorostiborane mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Cl (chlorine) 59.3% | Sb (antimony) 40.7%

Structure diagrams

  | sodium bromate | antimony pentachloride vertex count | 5 | 6 edge count | 3 | 5 Schultz index | 36 | 100 Wiener index | 9 | 25 Hosoya index | 4 | 6 Balaban index | 2.324 | 3.727
| sodium bromate | antimony pentachloride vertex count | 5 | 6 edge count | 3 | 5 Schultz index | 36 | 100 Wiener index | 9 | 25 Hosoya index | 4 | 6 Balaban index | 2.324 | 3.727

Basic properties

 | sodium bromate | antimony pentachloride molar mass | 150.89 g/mol | 299 g/mol phase | solid (at STP) | liquid (at STP) melting point | 381 °C | 2.8 °C boiling point | 1390 °C | 92 °C density | 3.339 g/cm^3 | 2.36 g/cm^3 solubility in water | soluble | soluble
| sodium bromate | antimony pentachloride molar mass | 150.89 g/mol | 299 g/mol phase | solid (at STP) | liquid (at STP) melting point | 381 °C | 2.8 °C boiling point | 1390 °C | 92 °C density | 3.339 g/cm^3 | 2.36 g/cm^3 solubility in water | soluble | soluble

Units

Liquid properties

 | antimony pentachloride density | 2.36 g/cm^3 vapor pressure | 6.721 mmHg dynamic viscosity | 0.00191 Pa s refractive index | 1.59255
| antimony pentachloride density | 2.36 g/cm^3 vapor pressure | 6.721 mmHg dynamic viscosity | 0.00191 Pa s refractive index | 1.59255

Units

Thermodynamic properties

 | sodium bromate | antimony pentachloride molar heat of vaporization | | 48.4 kJ/mol (kilojoules per mole) specific heat of vaporization | | 0.162 kJ/g (kilojoules per gram) molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 10.05 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.03361 kJ/g (kilojoules per gram)
| sodium bromate | antimony pentachloride molar heat of vaporization | | 48.4 kJ/mol (kilojoules per mole) specific heat of vaporization | | 0.162 kJ/g (kilojoules per gram) molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 10.05 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.03361 kJ/g (kilojoules per gram)

Solid properties

 | sodium bromate density | 3.339 g/cm^3
| sodium bromate density | 3.339 g/cm^3

Units

Chemical identifiers

 | sodium bromate | antimony pentachloride CAS number | 7789-38-0 | 7647-18-9 PubChem CID number | 23668195 | 24294 PubChem SID number | 24853461 | 24852875 SMILES identifier | [O-]Br(=O)=O.[Na+] | Cl[Sb](Cl)(Cl)(Cl)Cl InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/5ClH.Sb/h5*1H;/q;;;;;+5/p-5/f5Cl.Sb/h5*1h;/q5*-1;m/rCl5Sb/c1-6(2, 3, 4)5 RTECS number | EF8750000 | CC5075000 MDL number | MFCD00003476 | MFCD00011213
| sodium bromate | antimony pentachloride CAS number | 7789-38-0 | 7647-18-9 PubChem CID number | 23668195 | 24294 PubChem SID number | 24853461 | 24852875 SMILES identifier | [O-]Br(=O)=O.[Na+] | Cl[Sb](Cl)(Cl)(Cl)Cl InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/5ClH.Sb/h5*1H;/q;;;;;+5/p-5/f5Cl.Sb/h5*1h;/q5*-1;m/rCl5Sb/c1-6(2, 3, 4)5 RTECS number | EF8750000 | CC5075000 MDL number | MFCD00003476 | MFCD00011213

NFPA label

NFPA label
NFPA label
 | sodium bromate | antimony pentachloride NFPA health rating | | 3 NFPA fire rating | | 0 NFPA reactivity rating | | 1 NFPA hazards | oxidizing agent |
| sodium bromate | antimony pentachloride NFPA health rating | | 3 NFPA fire rating | | 0 NFPA reactivity rating | | 1 NFPA hazards | oxidizing agent |

Safety properties

 | sodium bromate | antimony pentachloride flash point | 381 °C | 77 °C
| sodium bromate | antimony pentachloride flash point | 381 °C | 77 °C
 | sodium bromate | antimony pentachloride DOT hazard class | 5.1 | 8 DOT numbers | 1494 | 1731
| sodium bromate | antimony pentachloride DOT hazard class | 5.1 | 8 DOT numbers | 1494 | 1731

Toxicity properties

 | sodium bromate | antimony pentachloride odor | odorless |  lethal dosage | | 1150 mg/kg
| sodium bromate | antimony pentachloride odor | odorless | lethal dosage | | 1150 mg/kg
 | sodium bromate | antimony pentachloride probable lethal dose for man | | 600 mL (milliliters) RTECS classes | tumorigen | human data | mutagen
| sodium bromate | antimony pentachloride probable lethal dose for man | | 600 mL (milliliters) RTECS classes | tumorigen | human data | mutagen