Input interpretation
potassium pyrosulfate
Chemical names and formulas
formula | K_2S_2O_7 Hill formula | K_2O_7S_2 name | potassium pyrosulfate IUPAC name | dipotassium sulfonato sulfate alternate names | dipotassium disulfate | dipotassium disulphate | dipotassium sulfonato sulfate | potassium disulfate | pyrosulfuric acid mass fractions | K (potassium) 30.7% | O (oxygen) 44% | S (sulfur) 25.2%
Structure diagram
Structure diagram
vertex count | 11 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
Basic properties
molar mass | 254.31 g/mol phase | solid (at STP) melting point | 325 °C density | 2.28 g/cm^3 solubility in water | soluble
Units
Solid properties (at STP)
density | 2.28 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 19.92 kJ/mol specific heat of fusion | 0.07833 kJ/g (at STP)
Chemical identifiers
![CAS number | 7790-62-7 PubChem CID number | 62681 PubChem SID number | 24858622 SMILES identifier | [O-]S(=O)(=O)OS(=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2K.H2O7S2/c;;1-8(2, 3)7-9(4, 5)6/h;;(H, 1, 2, 3)(H, 4, 5, 6)/q2*+1;/p-2/f2K.O7S2/q2m;-2 MDL number | MFCD00011385](../image_source/61fb4ab6c81be81bcde27a34869317a9.png)
CAS number | 7790-62-7 PubChem CID number | 62681 PubChem SID number | 24858622 SMILES identifier | [O-]S(=O)(=O)OS(=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2K.H2O7S2/c;;1-8(2, 3)7-9(4, 5)6/h;;(H, 1, 2, 3)(H, 4, 5, 6)/q2*+1;/p-2/f2K.O7S2/q2m;-2 MDL number | MFCD00011385